Flow objects
A chemical identity, independent of context and source. Every flow resolves to one of these.
| Name | Identifier | Type | Origin | Flows | Changes | CAS |
|---|---|---|---|---|---|---|
| N-(2-hydroxyethyl)ethylenediaminetriacetic Acid | fo-f13070f6063a115f | Neutral molecule | EF 3.1 | 13 | 59 | 150-39-0 |
| N-(2-hydroxyethyl)prop-2-enamide | fo-1d1a20cf5198618c | Neutral molecule | EF 3.1 | 13 | 55 | 7646-67-5 |
| N-(2-hydroxyethyl)stearamide | fo-ac71ef5f32e1b835 | Neutral molecule | EF 3.1 | 13 | 55 | 111-57-9 |
| N-(2-hydroxypropyl)octadec-9-enamide | fo-0fd22e0912422fe2 | Neutral molecule | EF 3.1 | 13 | 56 | 111-05-7 |
| N-(2-methoxy-5-methylphenyl)acetamide | fo-ce8ee700e4add39e | Neutral molecule | EF 3.1 | 13 | 55 | 6962-44-3 |
| N-(2-methoxyphenyl)-3-oxobutanamide | fo-8f117ac1a074980b | Neutral molecule | EF 3.1 | 13 | 55 | 92-15-9 |
| N-(2-methylphenyl)imidodicarbonimidic Diamide | fo-e88d9c30eb58e220 | Neutral molecule | EF 3.1 | 13 | 55 | 93-69-6 |
| N-(2-methylsulfinyl-1,1-dimethyl-ethyl)-n'-{2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl}phthalamide | fo-ab9687a8ac3906d8 | Neutral molecule | EF 3.1 | 13 | 55 | 371771-07-2 |
| N-(2-nitrophenyl)phosphoric Triamide | fo-c826389444c52b80 | Neutral molecule | EF 3.1 | 13 | 55 | 874819-71-3 |
| N-(3-aminopropyl)-n-dodecylpropane-1,3-diamine/n | fo-6a0b589396e2de1f | Neutral molecule | EF 3.1 | 13 | 55 | 2372-82-9 |
| N-(3-aminopropyl)-n-methylpropane-1,3-diamine | fo-b41da8160fd0e65b | Neutral molecule | EF 3.1 | 13 | 55 | 105-83-9 |
| N-(3-chloro-4-methylphenyl)acetamide | fo-ce18350348dbe4ad | Neutral molecule | EF 3.1 | 13 | 58 | 7149-79-3 |
| N-(3-{1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]trisiloxan-3-yl}propyl)prop-2-enamide | fo-7b636c68c589bb19 | Neutral molecule | EF 3.1 | 13 | 55 | 115258-10-1 |
| N-(4-acetamidophenyl)-3-hydroxy-2-naphthamide | fo-ae4f66bd36b6e7a6 | Neutral molecule | EF 3.1 | 13 | 55 | 41506-62-1 |
| N-(4-acetamidophenyl)-4-[(5-carbamoyl-2-chlorophenyl)diazenyl]-3-hydroxy-2-naphthamide | fo-4773c9b82519caaa | Neutral molecule | EF 3.1 | 13 | 55 | 12236-64-5 |
| N-(4-amino-2,5-diethoxyphenyl)benzamide | fo-6a351377eaaa51af | Neutral molecule | EF 3.1 | 13 | 55 | 120-00-3 |
| N-(4-amino-3-methoxy-9,10-dioxo-9,10-dihydroanthracen-1-yl)-4-methylbenzenesulfonamide | fo-4acbc011981cc738 | Neutral molecule | EF 3.1 | 13 | 55 | 81-68-5 |
| N-(4-aminophenyl)aniline | fo-3023bd99e1464c87 | Neutral molecule | EF 3.1 | 13 | 59 | 101-54-2 |
| N-(4-carbamoylphenyl)-4-({2-oxo-1-[(2-oxo-2,3-dihydro-1h-benzimidazol-5-yl)carbamoyl]propyl}diazenyl)benzamide | fo-2339ad565108ba7f | Neutral molecule | EF 3.1 | 13 | 55 | 74441-05-7 |
| N-(4-carbamoylphenyl)-4-nitrobenzamide | fo-e61edc755f0a59ec | Neutral molecule | EF 3.1 | 13 | 55 | 93839-21-5 |
| N-(4-chloro-2,5-dimethoxyphenyl)-2-{[2,5-dimethoxy-4-(phenylsulfamoyl)phenyl]diazenyl}-3-oxobutanamide | fo-2f03c97ec0abbda0 | Neutral molecule | EF 3.1 | 13 | 55 | 12225-18-2 |
| N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-4-{[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-2-naphthamide | fo-7143e7ff53c3227c | Neutral molecule | EF 3.1 | 13 | 55 | 5280-68-2 |
| N-(4-chloro-2,5-dimethoxyphenyl)-3-oxobutanamide | fo-8682e076a3903656 | Neutral molecule | EF 3.1 | 13 | 55 | 4433-79-8 |
| N-(4-chlorobenzyl)cyclopentanamine | fo-7c5514a7823345c9 | Neutral molecule | EF 3.1 | 13 | 55 | 66063-15-8 |
| N-(4-hydroxyphenyl)benzenesulfonamide | fo-9d33c7afa5eb46d1 | Neutral molecule | EF 3.1 | 13 | 55 | 5471-90-9 |
| N-(4-methyl-3-nitrophenyl)-4-[(4-methylpiperazin-1-yl)methyl]benzamide | fo-4bb7220040f5d3ee | Neutral molecule | EF 3.1 | 13 | 55 | 581076-60-0 |
| N-(4-{[3-(dimethylamino)propyl]sulfamoyl}phenyl)-2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide | fo-0d60516e62326978 | Neutral molecule | EF 3.1 | 13 | 55 | 1065519-44-9 |
| N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide | fo-7e4d51d99f309cbe | Neutral molecule | EF 3.1 | 13 | 55 | 105076-77-5 |
| N-(5-chloro-2,4-dimethoxyphenyl)-4-{[5-(diethylsulfamoyl)-2-methoxyphenyl]diazenyl}-3-hydroxy-2-naphthamide | fo-ca8d95b5cd9bb38d | Neutral molecule | EF 3.1 | 13 | 55 | 6410-41-9 |
| N-(5-chloro-2-methoxyphenyl)-2-[(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide | fo-165405fc8230ff3a | Neutral molecule | EF 3.1 | 13 | 55 | 15993-42-7 |
| N-(5-chloro-2-methoxyphenyl)-3-hydroxy-4-{[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-2-naphthamide | fo-743431e1938721c3 | Neutral molecule | EF 3.1 | 13 | 55 | 67990-05-0 |
| N-(5-chloro-2-methylphenyl)-3-hydroxy-4-{[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-2-naphthamide | fo-73ae7871fdef9d1c | Neutral molecule | EF 3.1 | 13 | 55 | 68227-78-1 |
| N-(5-nitro-2-furfurylidene)-1-amino-hydantoin | fo-a8f07d6ecd3354ff | Neutral molecule | EF 3.1 | 13 | 57 | 67-20-9 |
| N-(9-oxo-2-fluorenyl)acetamide | fo-086baa1c9e6dde70 | Neutral molecule | EF 3.1 | 13 | 56 | 3096-50-2 |
| N-(cyclohexylthio)phthalimide | fo-c6f52568a8c5c4b5 | Neutral molecule | EF 3.1 | 13 | 58 | 17796-82-6 |
| N-(hydroxymethyl)-2-methylacrylamide | fo-d2b2b051af1e2737 | Neutral molecule | EF 3.1 | 13 | 55 | 923-02-4 |
| N-(n-octyl)-2-pyrrolidinone | fo-5cfd6b9837f99e5f | Neutral molecule | EF 3.1 | 13 | 56 | 2687-94-7 |
| N-(tetrahydrofuran-3-ylmethyl)amine | fo-02b9dc5407870ce9 | Neutral molecule | EF 3.1 | 13 | 55 | 165253-31-6 |
| N-1,3-dimethylbutyl-N'-phenyl-p-phenylenediamine | fo-c1b9260a1fa5aa06 | Neutral molecule | EF 3.1 | 13 | 59 | 793-24-8 |
| N-2-naphthylaniline | fo-cdfb2add6a28d896 | Neutral molecule | EF 3.1 | 13 | 59 | 135-88-6 |
| N-4-(4'-fluorobiphenyl)acetamide | fo-c66507a98bf33cab | Neutral molecule | EF 3.1 | 13 | 57 | 398-32-3 |
| N-[(1,1,3,3-tetramethylbutyl)phenyl]naphthalen-1-amine | fo-9372285d8d192ed8 | Neutral molecule | EF 3.1 | 13 | 55 | 51772-35-1 |
| N-[(2s,3r,4s)-2,3,4,6-tetrahydroxy-5-oxohexyl]formamide | fo-52fc46383f845289 | Neutral molecule | EF 3.1 | 13 | 56 | 115241-16-2 |
| N-[(6-chloro-3-pyridinyl)methyl]-1,2-ethane-diamine | fo-ae393c0e71739d9e | Neutral molecule | EF 3.1 | 13 | 55 | 101990-44-7 |
| N-[(6-chloropyridin-3-yl)methyl]-2,2-difluoroethanamine | fo-fb5dfce77d884906 | Neutral molecule | EF 3.1 | 13 | 55 | 1003859-14-0 |
| N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]acetamide | fo-088f5557a2913d78 | Neutral molecule | EF 3.1 | 13 | 55 | 877179-03-8 |
| N-[2-hydroxy-1-(hydroxymethyl)heptadecyl]-9-octadecenamide | fo-50550d78675e6466 | Neutral molecule | EF 3.1 | 13 | 56 | 54422-45-6 |
| N-[3-(dimethylamino)propyl]-2-methylacrylamide | fo-742c855d2a65e0cd | Neutral molecule | EF 3.1 | 13 | 56 | 5205-93-6 |
| N-[3-(dimethylamino)propyl]-n,n',n'-trimethylpropane-1,3-diamine | fo-0297fc91756b4523 | Neutral molecule | EF 3.1 | 13 | 55 | 3855-32-1 |
| N-[3-(dimethylamino)propyl]acrylamide | fo-668b2f420e1e87d1 | Neutral molecule | EF 3.1 | 13 | 55 | 3845-76-9 |