Bis(2,4-dichlorophenyl)peroxyanhydride
fo-138c7a1fdcfc558a
Identity
- Type
- Neutral molecule
- CAS
- 133-14-2
- EC
- 205-094-9
- Origin
- EF 3.1 hybrid_name_cas_v1
- Changes
- 55 across every transformer
Structure
Alternative labels
22- 2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate
- 2,4-Dichlorobenzoyl peroxide
- 2,4-Dichlorobibenzoyl peroxide
- Bis(2,4-dichlorobenzoyl) peroxide
- Cadox TDP
- Cadox TS
- Cadox TS 50
- Chaloxyd DCLBP 50PSI
- DCBP
- DCLBP 50PSI
- Di(2,4-dichlorobenzoyl)peroxide
- Elastosil AUX Crosslinker E
- Elastosil AUX-E
- Luperco CST
- Noviper DB 50
- o,o′,p,p′-Tetrachlorodibenzoyl peroxide
- Perkadox PD 50S
- Perkadox PD 50S-PS
- Peroxide, bis(2,4-dichlorobenzoyl)
- Siloprene CL 40
- Varox DCBP 50
- Xiameter RBM 9020
Properties
| Property | Value |
|---|---|
| InChI2D key string chemrof:inchi2d_key_string | WRXCBRHBHGNNQA-UHFFFAOYSA-N |
| InChI2D string chemrof:inchi2d_string | InChI=1S/C14H6Cl4O4/c15-7-1-3-9(11(17)5-7)13(19)21-22-14(20)10-4-2-8(16)6-12(10)18/h1-6H |
| IUPAC name chemrof:IUPAC_name | 2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate |
| Molecular formula chemrof:molecular_formula | C14H6Cl4O4 |
| Molecular mass chemrof:molecular_mass | 380.01 |
| Monoisotopic mass chemrof:monoisotopic_mass | 377.902019 |
| SMILES string chemrof:smiles_string | O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
Known URLs
9Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.
| Resource | URL | Recorded by |
|---|---|---|
| CAS Common Chemistry | https://commonchemistry.cas.org/detail?cas_rn=133-14-2 | enrich_references.consensus_cas_link |
| chem.echa.europa.eu | https://chem.echa.europa.eu/100.004.633 | enrich_references.pubchem_identifier_url |
| comptox.epa.gov | https://comptox.epa.gov/dashboard/DTXSID4044539 | enrich_references.pubchem_identifier_url |
| gsrs.ncats.nih.gov | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/0QC93Y0L96 | enrich_references.pubchem_identifier_url |
| jglobal.jst.go.jp | http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J2.524K | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/compound/61078 | enrich_references.pubchem_compound |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/erg/#3102 | enrich_references.pubchem_identifier_url |
| PubChem | https://pubchem.ncbi.nlm.nih.gov/erg/#3116 | enrich_references.pubchem_identifier_url |
| Wikidata | https://www.wikidata.org/wiki/Q27237102 | enrich_references.pubchem_identifier_url |
Elementary flows
13| Flow | Context | Source | Unit | CFs |
|---|---|---|---|---|
| 735b2835-60f9-4bbe-988d-fd57bb59a843 | Environmental → Air → Aircraft cruise height | EF 3.1 | kg | 4 |
| 6974b226-edf9-4fbc-ae04-dbfbb54e5636 | Environmental → Air → Ground level → Urban (>1000 people/square mile) | EF 3.1 | kg | 4 |
| 6cede0e9-205f-46e4-83d8-71dfb3a58a87 | Environmental → Air → Indoor | EF 3.1 | kg | 4 |
| f2e360d6-fc81-4ff9-810e-31585263b8e2 | Environmental → Air → Long-term | EF 3.1 | kg | 0 |
| e60849fc-208f-4939-8d88-7f4d3c89769a | Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile) | EF 3.1 | kg | 4 |
| 07a0c29e-bb18-4e24-8f6b-677c635b00c1 | Environmental → Air → Unknown | EF 3.1 | kg | 4 |
| 21ef4186-144c-4adf-9418-042759daadf5 | Environmental → Ground → Agricultural | EF 3.1 | kg | 4 |
| a85defca-6414-4930-a282-7f9b8618c5b5 | Environmental → Ground → Non-agricultural | EF 3.1 | kg | 4 |
| eac057ae-9d85-45fd-b101-b315bfb6aee1 | Environmental → Ground → Unknown | EF 3.1 | kg | 4 |
| 709227e8-db97-460f-a4c9-69f0123bb399 | Environmental → Water → Long-term | EF 3.1 | kg | 0 |
| eec7e793-b3b5-4e55-9846-d526be183d19 | Environmental → Water → Ocean | EF 3.1 | kg | 4 |
| fd717d31-8c8a-4c0a-bb39-30ac9dd383a6 | Environmental → Water → Surface water | EF 3.1 | kg | 4 |
| f941dfed-386e-4b96-a71d-6cc7d98d7da8 | Environmental → Water → Unknown | EF 3.1 | kg | 4 |
History
Everything that changed this substance (55 changes)
Full record
Flow object JSON
{
"flow_object_id": "fo-138c7a1fdcfc558a",
"prefLabel": [
{
"@value": "Bis(2,4-dichlorophenyl)peroxyanhydride",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,4-Dichlorobenzoyl peroxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,4-Dichlorobibenzoyl peroxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Bis(2,4-dichlorobenzoyl) peroxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cadox TDP",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cadox TS",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cadox TS 50",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chaloxyd DCLBP 50PSI",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "DCBP",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "DCLBP 50PSI",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Di(2,4-dichlorobenzoyl)peroxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Elastosil AUX Crosslinker E",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Elastosil AUX-E",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Luperco CST",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Noviper DB 50",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "o,o′,p,p′-Tetrachlorodibenzoyl peroxide",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Perkadox PD 50S",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Perkadox PD 50S-PS",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Peroxide, bis(2,4-dichlorobenzoyl)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Siloprene CL 40",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Varox DCBP 50",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Xiameter RBM 9020",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CAS:133-14-2",
"EF 3.1",
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C14H6Cl4O4"
],
"attested_by": {
"C14H6Cl4O4": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"WRXCBRHBHGNNQA-UHFFFAOYSA-N"
],
"attested_by": {
"WRXCBRHBHGNNQA-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
],
"attested_by": {
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C14H6Cl4O4/c15-7-1-3-9(11(17)5-7)13(19)21-22-14(20)10-4-2-8(16)6-12(10)18/h1-6H"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
],
"attested_by": {
"InChI=1S/C14H6Cl4O4/c15-7-1-3-9(11(17)5-7)13(19)21-22-14(20)10-4-2-8(16)6-12(10)18/h1-6H": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate"
]
},
"attested_by": {
"2,4-Dichlorobenzoyl 2,4-dichlorobenzene-1-carboperoxoate": [
"opsin_iupac"
]
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
380.01
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"C1=CC(=C(C=C1Cl)Cl)C(=O)OOC(=O)C2=C(C=C(C=C2)Cl)Cl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
],
"attested_by": {
"380.01": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
377.902019
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"C1=CC(=C(C=C1Cl)Cl)C(=O)OOC(=O)C2=C(C=C(C=C2)Cl)Cl"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"O=C(OOC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl"
]
}
],
"attested_by": {
"377.902019": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J2.524K",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://chem.echa.europa.eu/100.004.633",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=133-14-2",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"133-14-2"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
{
"@id": "https://comptox.epa.gov/dashboard/DTXSID4044539",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://gsrs.ncats.nih.gov/ginas/app/beta/substances/0QC93Y0L96",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/61078",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.by_cas[133-14-2]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#3102",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/erg/#3116",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
},
{
"@id": "https://www.wikidata.org/wiki/Q27237102",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"CID:61078;CAS:133-14-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[133-14-2]"
}
}
],
"created_from": {
"resolver": "hybrid_name_cas_v1",
"seed_uuid": "07a0c29e-bb18-4e24-8f6b-677c635b00c1",
"seed_source": "EF 3.1",
"semantic_typing": {
"rule": "neutral_molecule",
"reason": "",
"types": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"provenance": {
"prov:wasGeneratedBy": "semantic_typing.classify",
"prov:wasAttributedTo": "brightway-flows",
"prov:wasDerivedFrom": "semantic_typing.rule.neutral_molecule"
}
}
},
"classifications": {
"http://semanticscience.org/resource/CHEMINF_000446": {
"@value": [
"133-14-2"
],
"rdfs:seeAlso": [
"https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
],
"http://www.w3.org/2004/02/skos/core#exactMatch": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=133-14-2"
}
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "cas_numbers"
}
},
"http://semanticscience.org/resource/CHEMINF_000447": {
"@value": [
"205-094-9"
],
"rdfs:seeAlso": [
"https://echa.europa.eu/search-for-chemicals?query=205-094-9"
],
"provenance": {
"prov:wasGeneratedBy": "hybrid_name_cas_v1",
"prov:wasAttributedTo": "brightway-flows",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "ec_numbers"
}
}
},
"origin_qualifier": null,
"parent_flow_object_id": null,
"parent_intervention_id": null,
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
]
}Something wrong here?
- This substance is published under the wrong name
- This is not that chemical
- This record is two substances, or it is a second copy of one
You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works