Sodium Dibutyldithiocarbamate

Accel TP
Accelerator TP
Butyl Namate
Carbamic acid, dibutyldithio-, sodium salt
Carbamodithioic acid, dibutyl-, sodium salt
Carbamodithioic acid, N,N-dibutyl-, sodium salt (1:1)
Dibutyl sodium dithiocarbamate
Dibutyldithiocarbamic acid sodium salt
Nocceler TP
Pennac SDB
SDBC
Sodium DBDT
Sodium di-n-butyldithiocarbamate
Sodium N,N-dibutyldithiocarbamate
Tepidone
Tepidone rubber accelerator
Vulcacure NB

Property	Value
InChI2D key string chemrof:inchi2d_key_string	DQUKJTRRFYJQAS-UHFFFAOYSA-N, HUMLQUKVJARKRN-UHFFFAOYSA-M
InChI2D string chemrof:inchi2d_string	InChI=1S/C9H19NS2.Na/c1-3-5-7-10(9(11)12)8-6-4-2;/h3-8H2,1-2H3,(H,11,12);/q;+1/p-1
IUPAC name chemrof:IUPAC_name	Sodium Dibutyldithiocarbamate
Molecular formula chemrof:molecular_formula	C9H18NNaS2, C9H19NNaS2
SMILES string chemrof:smiles_string	CCCCN(CCCC)C(=S)[S-].[Na+]

Where else this substance is described. Collected while the pipeline resolved it — from ChEBI's cross-references, from PubChem's identifier list, and from the CAS number — so a link here is a record the merge actually read, not a search it suggests.

Resource	URL	Recorded by
CAS Common Chemistry	https://commonchemistry.cas.org/detail?cas_rn=136-30-1	enrich_references.pubchem_identifier_url
PubChem	https://pubchem.ncbi.nlm.nih.gov/compound/6331222	enrich_references.pubchem_compound

Flow	Context	Source	Unit	CFs
d3359ffa-4731-4d8d-aaa9-c537e4dd90cc	Environmental → Air → Aircraft cruise height	EF 3.1	kg	4
6a52ec70-e089-4739-9d78-80f36aa981e5	Environmental → Air → Ground level → Urban (>1000 people/square mile)	EF 3.1	kg	4
027e53cc-85a6-45d9-951d-7ce72a75af29	Environmental → Air → Indoor	EF 3.1	kg	4
f960cc7e-f4d6-4216-a8cf-d6240d1e35f9	Environmental → Air → Long-term	EF 3.1	kg	0
7087d494-a4d1-4c5e-83e1-c46dada1b32b	Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile)	EF 3.1	kg	4
6c34f511-1017-46bc-8e8d-1dc72694214e	Environmental → Air → Unknown	EF 3.1	kg	4
81e20574-c89b-4a73-9405-a2c67c0f9ced	Environmental → Ground → Agricultural	EF 3.1	kg	4
fda9fc45-eae8-4c98-b949-4720901a59c3	Environmental → Ground → Non-agricultural	EF 3.1	kg	4
ed336358-25bb-49e1-b190-92deb54f3325	Environmental → Ground → Unknown	EF 3.1	kg	4
f4c13b2b-4bb0-4117-b85e-8b6f0ed174f1	Environmental → Water → Long-term	EF 3.1	kg	0
b3c6fc13-f4c2-4c31-9114-e97f6156b4a3	Environmental → Water → Ocean	EF 3.1	kg	4
e05c0c8f-2488-4059-a758-5b3d3e305e9e	Environmental → Water → Surface water	EF 3.1	kg	4
1d6ee043-4351-41c7-95bc-ef0bd6906c1b	Environmental → Water → Unknown	EF 3.1	kg	4

Everything that changed this substance (55 changes)

Open the changes page

Flow object JSON

{
  "flow_object_id": "fo-dfd33c4633244334",
  "prefLabel": [
    {
      "@value": "Sodium Dibutyldithiocarbamate",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "bootstrap_labels",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "EF 3.1"
        ],
        "prov:wasDerivedFrom": "legacy name field"
      }
    }
  ],
  "altLabel": [
    {
      "@value": "Accel TP",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Accelerator TP",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Butyl Namate",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbamic acid, dibutyldithio-, sodium salt",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbamodithioic acid, dibutyl-, sodium salt",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Carbamodithioic acid, N,N-dibutyl-, sodium salt (1:1)",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Dibutyl sodium dithiocarbamate",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Dibutyldithiocarbamic acid sodium salt",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Nocceler TP",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Pennac SDB",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "SDBC",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Sodium DBDT",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Sodium di-n-butyldithiocarbamate",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Sodium N,N-dibutyldithiocarbamate",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Tepidone",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Tepidone rubber accelerator",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    },
    {
      "@value": "Vulcacure NB",
      "@language": "en",
      "@lang": "en",
      "provenance": {
        "prov:wasGeneratedBy": "consensus_match",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CAS:136-30-1",
          "EF 3.1",
          "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        ],
        "prov:wasDerivedFrom": "common chemistry CAS lookup"
      }
    }
  ],
  "properties": {
    "https://w3id.org/chemrof/molecular_formula": {
      "@id": "https://w3id.org/chemrof/molecular_formula",
      "@value": [
        "C9H18NNaS2",
        "C9H19NNaS2"
      ],
      "attested_by": {
        "C9H19NNaS2": [
          "enrich_references.pubchem_semantic"
        ],
        "C9H18NNaS2": [
          "rdkit_post_consensus"
        ]
      },
      "rdfs:label": "Molecular formula",
      "provenance": [
        {
          "prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CID:6331222"
          ],
          "prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CCCCN(CCCC)C(=S)[S-].[Na+]"
          ]
        }
      ]
    },
    "https://w3id.org/chemrof/inchi2d_key_string": {
      "@id": "https://w3id.org/chemrof/inchi2d_key_string",
      "@value": [
        "DQUKJTRRFYJQAS-UHFFFAOYSA-N",
        "HUMLQUKVJARKRN-UHFFFAOYSA-M"
      ],
      "attested_by": {
        "DQUKJTRRFYJQAS-UHFFFAOYSA-N": [
          "enrich_references.pubchem_semantic"
        ],
        "HUMLQUKVJARKRN-UHFFFAOYSA-M": [
          "rdkit_post_consensus"
        ]
      },
      "rdfs:label": "InChIKey",
      "provenance": [
        {
          "prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CID:6331222"
          ],
          "prov:wasDerivedFrom": "pubchem.props.InChIKey"
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CCCCN(CCCC)C(=S)[S-].[Na+]"
          ]
        }
      ]
    },
    "https://w3id.org/chemrof/smiles_string": {
      "@id": "https://w3id.org/chemrof/smiles_string",
      "rdfs:label": "SMILES",
      "@value": [
        "CCCCN(CCCC)C(=S)[S-].[Na+]"
      ],
      "provenance": [
        {
          "prov:wasGeneratedBy": "opsin_iupac",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "Sodium Dibutyldithiocarbamate"
          ]
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CCCCN(CCCC)C(=S)[S-].[Na+]"
          ]
        }
      ],
      "attested_by": {
        "CCCCN(CCCC)C(=S)[S-].[Na+]": [
          "opsin_iupac",
          "rdkit_post_consensus"
        ]
      }
    },
    "https://w3id.org/chemrof/inchi2d_string": {
      "@id": "https://w3id.org/chemrof/inchi2d_string",
      "rdfs:label": "InChI",
      "@value": [
        "InChI=1S/C9H19NS2.Na/c1-3-5-7-10(9(11)12)8-6-4-2;/h3-8H2,1-2H3,(H,11,12);/q;+1/p-1"
      ],
      "provenance": [
        {
          "prov:wasGeneratedBy": "opsin_iupac",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "Sodium Dibutyldithiocarbamate"
          ]
        },
        {
          "prov:wasGeneratedBy": "rdkit_post_consensus",
          "prov:wasAttributedTo": "brightway-flows",
          "prov:hadPrimarySource": [
            "CCCCN(CCCC)C(=S)[S-].[Na+]"
          ]
        }
      ],
      "attested_by": {
        "InChI=1S/C9H19NS2.Na/c1-3-5-7-10(9(11)12)8-6-4-2;/h3-8H2,1-2H3,(H,11,12);/q;+1/p-1": [
          "opsin_iupac",
          "rdkit_post_consensus"
        ]
      }
    },
    "https://w3id.org/chemrof/IUPAC_name": {
      "@id": "https://w3id.org/chemrof/IUPAC_name",
      "rdfs:label": "IUPAC name",
      "@value": [
        "Sodium Dibutyldithiocarbamate"
      ],
      "provenance": {
        "prov:wasGeneratedBy": "opsin_iupac",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "Sodium Dibutyldithiocarbamate"
        ]
      },
      "attested_by": {
        "Sodium Dibutyldithiocarbamate": [
          "opsin_iupac"
        ]
      }
    }
  },
  "references": [
    {
      "@id": "https://commonchemistry.cas.org/detail?cas_rn=136-30-1",
      "provenance": {
        "prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CID:6331222;CAS:136-30-1"
        ],
        "prov:wasDerivedFrom": "pubchem.identifiers[136-30-1]"
      }
    },
    {
      "@id": "https://pubchem.ncbi.nlm.nih.gov/compound/6331222",
      "provenance": {
        "prov:wasGeneratedBy": "enrich_references.pubchem_compound",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "CID:6331222;CAS:136-30-1"
        ],
        "prov:wasDerivedFrom": "pubchem.by_cas[136-30-1]"
      }
    }
  ],
  "created_from": {
    "resolver": "hybrid_name_cas_v1",
    "seed_uuid": "027e53cc-85a6-45d9-951d-7ce72a75af29",
    "seed_source": "EF 3.1",
    "semantic_typing": {
      "rule": "multi_component_ionic",
      "reason": "",
      "types": [
        "https://w3id.org/chemrof/ChemicalSalt"
      ],
      "provenance": {
        "prov:wasGeneratedBy": "semantic_typing.classify",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:wasDerivedFrom": "semantic_typing.rule.multi_component_ionic"
      }
    }
  },
  "classifications": {
    "http://semanticscience.org/resource/CHEMINF_000446": {
      "@value": [
        "136-30-1"
      ],
      "rdfs:seeAlso": [
        "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
      ],
      "http://www.w3.org/2004/02/skos/core#exactMatch": [
        {
          "@id": "https://commonchemistry.cas.org/detail?cas_rn=136-30-1"
        }
      ],
      "provenance": {
        "prov:wasGeneratedBy": "hybrid_name_cas_v1",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "EF 3.1"
        ],
        "prov:wasDerivedFrom": "cas_numbers"
      }
    },
    "http://semanticscience.org/resource/CHEMINF_000447": {
      "@value": [
        "205-238-0"
      ],
      "rdfs:seeAlso": [
        "https://echa.europa.eu/search-for-chemicals?query=205-238-0"
      ],
      "provenance": {
        "prov:wasGeneratedBy": "hybrid_name_cas_v1",
        "prov:wasAttributedTo": "brightway-flows",
        "prov:hadPrimarySource": [
          "EF 3.1"
        ],
        "prov:wasDerivedFrom": "ec_numbers"
      }
    }
  },
  "origin_qualifier": null,
  "parent_flow_object_id": null,
  "parent_intervention_id": null,
  "@type": [
    "https://w3id.org/chemrof/ChemicalSalt"
  ]
}

You do not need to run a build or clone anything. Name the record and say what your evidence is; the measurement is done for you. How contributing works

Sodium Dibutyldithiocarbamate

Identity

Structure

Alternative labels

Properties

Known URLs

Elementary flows

History

Full record

Something wrong here?

Keyboard