Sodium Dalapon
4d9a8790-3ddd-11dd-908e-0050c2490048
Identity
- Substance
- fo-9d72ec3fffbfeca2 Chemical salt
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile)
- CAS
- 127-20-8
- EC
- 204-828-5
Context
- Dimension
- Environmental
- Media
- Air
- Population density
- Rural (<1000 people/square mile)
- Strata
- Medium stack, <150 meters
Alternative labels
24- 2,2-DPA Na salt
- 2,2-Dichloropropionic acid sodium salt
- Antigramigna
- Basfapon
- Dalapon sodium
- Dalapon sodium salt
- Dikopan
- Dowpon
- Dowpon S
- Gramevin
- Omnidel
- Omnidel Spezial
- Propanoic acid, 2,2-dichloro-, sodium salt
- Propanoic acid, 2,2-dichloro-, sodium salt (1:1)
- Propinate
- Propionic acid, 2,2-dichloro-, sodium salt
- Radapon
- SYS 67 Omnidel
- Sodium 2,2-dichloropropionate
- Sodium 2,2-dichloropropionic acid
- Sodium dichloropropionate
- Sodium α,α-dichloropropionate
- Tafapon
- α,α-Dichloropropionic acid sodium salt
Source lists
2| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | 4d9a8790-3ddd-11dd-908e-0050c2490048 | sodium dalapon | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
| ecoinvent | 3.12 | 7102a731-5687-5d5d-b354-32d31fe01176 | Dalapon-sodium | A curator's mapping table (ecoinvent-3.11-biosphere-EF-3.1-biosphere) names this flow. |
Concept associations
2| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | 4d9a8790-3ddd-11dd-908e-0050c2490048 | sodium dalapon | Emissions/Emissions to air/Emissions to non-urban air or from high stacks | exactMatch | — |
| ecoinvent 3.12 | 7102a731-5687-5d5d-b354-32d31fe01176 | Dalapon-sodium | air / non-urban air or from high stacks | exactMatch | — |
Characterisation factors
6- consensus-flow-list 2
- European Commission — JRC 2
- ecoinvent Centre 2
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 772.74 | — |
| EF 3.1 | ecoinvent Centre | Ecotoxicity, freshwater | — | 772.74 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 772.74 | agreed |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 772.74 | — |
| EF 3.1 | ecoinvent Centre | Ecotoxicity, freshwater_organics | — | 772.74 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 772.74 | agreed |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "2,2-DPA Na salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "2,2-Dichloropropionic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Antigramigna",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Basfapon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dalapon sodium",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dalapon sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dikopan",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dowpon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dowpon S",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Gramevin",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Omnidel",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Omnidel Spezial",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propanoic acid, 2,2-dichloro-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propanoic acid, 2,2-dichloro-, sodium salt (1:1)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propinate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Propionic acid, 2,2-dichloro-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Radapon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SYS 67 Omnidel",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 2,2-dichloropropionate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 2,2-dichloropropionic acid",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium dichloropropionate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium α,α-dichloropropionate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Tafapon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "α,α-Dichloropropionic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:127-20-8",
"https://commonchemistry.cas.org/detail?cas_rn=127-20-8"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C3H3Cl2NaO2",
"C3H4Cl2NaO2"
],
"attested_by": {
"C3H4Cl2NaO2": [
"enrich_references.pubchem_semantic"
],
"C3H3Cl2NaO2": [
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:16212964"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(Cl)(Cl)C(=O)[O-].[Na+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"MCCBUOJFZJOBJH-UHFFFAOYSA-N",
"PDEFQWNXOUGDJR-UHFFFAOYSA-M"
],
"attested_by": {
"MCCBUOJFZJOBJH-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"PDEFQWNXOUGDJR-UHFFFAOYSA-M": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:16212964"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(Cl)(Cl)C(=O)[O-].[Na+]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"CC(Cl)(Cl)C(=O)[O-].[Na+]"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2,2-Dichloropropionic acid sodium salt"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(Cl)(Cl)C(=O)[O-].[Na+]"
]
}
],
"attested_by": {
"CC(Cl)(Cl)C(=O)[O-].[Na+]": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C3H4Cl2O2.Na/c1-3(4,5)2(6)7;/h1H3,(H,6,7);/q;+1/p-1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2,2-Dichloropropionic acid sodium salt"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CC(Cl)(Cl)C(=O)[O-].[Na+]"
]
}
],
"attested_by": {
"InChI=1S/C3H4Cl2O2.Na/c1-3(4,5)2(6)7;/h1H3,(H,6,7);/q;+1/p-1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"2,2-Dichloropropionic acid sodium salt"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2,2-Dichloropropionic acid sodium salt"
]
},
"attested_by": {
"2,2-Dichloropropionic acid sodium salt": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=127-20-8",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:16212964;CAS:127-20-8"
],
"prov:wasDerivedFrom": "pubchem.identifiers[127-20-8]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/16212964",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:16212964;CAS:127-20-8"
],
"prov:wasDerivedFrom": "pubchem.by_cas[127-20-8]"
}
}
],
"prefLabel": [
{
"@value": "Sodium Dalapon",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/ChemicalSalt"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "4d9a8790-3ddd-11dd-908e-0050c2490048",
"identifier": "4d9a8790-3ddd-11dd-908e-0050c2490048",
"source": "EF 3.1",
"cas_numbers": [
"127-20-8"
],
"ec_numbers": [
"204-828-5"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Medium stack, <150 meters",
"population_density": "Rural (<1000 people/square mile)"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 772.74
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 772.74
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-mest15me-ru10pesq",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-9d72ec3fffbfeca2",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/4d9a8790-3ddd-11dd-908e-0050c2490048",
"skos:prefLabel": "sodium dalapon",
"context": "Emissions/Emissions to air/Emissions to non-urban air or from high stacks",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/4d9a8790-3ddd-11dd-908e-0050c2490048"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/4d9a8790-3ddd-11dd-908e-0050c2490048"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
},
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ecoinvent/3.12/flow/7102a731-5687-5d5d-b354-32d31fe01176",
"skos:prefLabel": "Dalapon-sodium",
"context": "air / non-urban air or from high stacks",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/4d9a8790-3ddd-11dd-908e-0050c2490048"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/4d9a8790-3ddd-11dd-908e-0050c2490048"
},
"provenance": {
"prov:wasGeneratedBy": "merge_ecoinvent",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent:3.12:7102a731-5687-5d5d-b354-32d31fe01176",
"Dalapon-sodium",
"ecoinvent-3.11-biosphere-EF-3.1-biosphere"
],
"prov:wasDerivedFrom": "randonneur_replace_table:prepared_mapping"
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "consensus_match",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"127-20-8": "exactMatch"
},
"general_comment": "Correct mapping CAS and flow to be verified: yet unclear whether this is the sodium-, hydrochloride-, calcium-, potassium- or other salt or the pure substance that is emitted. Note that the CAS No is the relevant identifier, to which also the ILCD LCIA characterisation factors relate. Reference elementary flow of the International Reference Life Cycle Data System (ILCD).",
"_transformed": true,
"_provided": {
"name": "sodium dalapon",
"synonyms": [
".alpha.,.alpha.-Dichloropropionic acid",
".alpha.-Dichloropropionic acid",
"2,2-DPA",
"2,2-Dichloropropanoic acid",
"2,2-Dichloropropionic acid",
"AC1L1MHL",
"AC1Q1R2O",
"AC1Q3GLT",
"Alatex",
"BH dalapon",
"Basfapon B",
"Basfapon/basfapon N",
"Basinex",
"Basinex P",
"Crisapon",
"D-Granulat",
"DALAPON",
"Dalapon 85",
"Dalapon [ANSI:BSI]",
"Dalascam",
"Dawpon-Rae",
"Dowpon M",
"Dowpon NF",
"I14-9742",
"Kenapon",
"Kyselina 2,2-dichlorpropionova",
"LTBB002886",
"Liropon",
"NDUPDOJHUQKPAG-UHFFFAOYSA-",
"Omnidel",
"Propanoic acid, 2,2-dichloro-",
"Propionic acid, 2,2-dichloro-",
"Proprop",
"Revenge",
"S 1315",
"S 95 (herbicide)",
"Sys-Omnidel",
"Tripon",
"Unipon",
"alpha,alpha-Dichloropropionic acid"
],
"context": [
"Emissions",
"Emissions to air",
"Emissions to non-urban air or from high stacks"
],
"cas_numbers": [
"127-20-8"
],
"ec_numbers": [
"204-828-5"
],
"unit": "kg"
}
}