Tris(methylphenyl) Phosphate
Everything that changed this flow. Back to the flow
82188b29-fc46-4322-ad02-809450df75d8
By field
14 fields| Field | Changes | Written by | Latest note |
|---|---|---|---|
| properties | 5 | enrich_references, opsin_iupac, rdkit_post_consensus, rdkit_pre_consensus, withhold_ambiguous_mass | withhold_ambiguous_mass: removed molecular_mass, monoisotopic_mass; the flow carries 4 candidate structures, so no one mass describes it |
| altLabel | 2 | consensus_match, strip_catalogue_altlabels | Removed 8 catalogue altLabel value(s): 'Celluflex 179C' (trade name), 'Durad 124' (trade name), 'Durad 125' (trade name), 'Fyrquel 150' (trade name), 'Phosphlex 179A' (trade name), 'RB 6' (grade code), 'T 306' (grade code), 'T 306 (antiwear agent)' (grade code) |
| prefLabel | 2 | bootstrap_labels, normalize_name_case | Title-cased words without internal capitals (preserved words with uppercase letters beyond the first character) |
| cas_match_labels | 1 | consensus_match | group_key=tris(methylphenyl)phosphate||dimension=Environmental > media=Water > water_body=Surface water; group_sources=['ec_inventory', 'pubchem']; cas_sources={'1330-78-5': ['ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-06574d9e224fb032: {'1330-78-5': 'exactMatch'} |
| concept_associations | 1 | carry_associations_onto_flows | associations resolved on the elementary layer |
| context | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to air > Emissions to air, indoor |
| context_iri | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to air > Emissions to air, indoor |
| ec_numbers | 1 | ec_cross_check | Added PubChem-confirmed EC: 215-548-8 |
| name | 1 | bootstrap_labels | Purged legacy name field to enforce prefLabel usage |
| references | 1 | enrich_references | Added references with provenance; cas_numbers=['1330-78-5']; matched_chebi_ids=[]; candidate_pubchem_cids=[5564, 6527, 6529, 11232, 2724691, 44630431, 57501505, 76961998]; selected_pubchem_cids=[6529, 44630431, 57501505, 76961998]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| skos_definition | 1 | enrich_references | Merged ChEBI/PubChem definitions into skos:definition |
| synonyms | 1 | bootstrap_labels | Removed legacy synonyms field in favor of structured labels |
| types | 1 | link_flows_to_their_substance | the substance's answer, copied onto its flow |
| unit_iri | 1 | unit_normalization | Unit IRI set from normalization of 'kg' |
Where several steps wrote one field, the last one won — and the log below shows the sequence.
Changes
20| # | Step | Field | From | To | Why |
|---|---|---|---|---|---|
| 290 | bootstrap_labels | prefLabel | — | [{"@value":"tris(methylphenyl) phosphate","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:was… | Bootstrapped prefLabel from legacy name field |
| 291 | bootstrap_labels | name | tris(methylphenyl) phosphate | — | Purged legacy name field to enforce prefLabel usage |
| 23,970 | bootstrap_labels | synonyms | ["tris(methylphenyl)phosphate","disflamolltkp","disflamolltkp-p","durad125","fromcoreofos908","fromcotcp/txp","kronitex… | [] | Removed legacy synonyms field in favor of structured labels |
| 127,114 | default_context_mapping | context | — | {"dimension":"Environmental","media":"Air","indoor":"Unknown"} | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to air > Emissions to air, indoor |
| 127,115 | default_context_mapping | context_iri | — | https://vocab.brightway.one/flow-contexts/envi-air-indr-unkn | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to air > Emissions to air, indoor |
| 213,435 | unit_normalization | unit_iri | — | https://vocab.brightway.one/units/unit/KiloGM | Unit IRI set from normalization of 'kg' |
| 221,157 | normalize_name_case | prefLabel | [{"@value":"tris(methylphenyl) phosphate","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:was… | [{"@value":"Tris(methylphenyl) Phosphate","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:was… | Title-cased words without internal capitals (preserved words with uppercase letters beyond the first character) |
| 226,720 | ec_cross_check | ec_numbers | ["809-930-9"] | ["809-930-9","215-548-8"] | Added PubChem-confirmed EC: 215-548-8 |
| 227,445 | enrich_references | properties | {} | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | Added ChEBI/PubChem properties (chebi_ids=0, pubchem_cids=4) |
| 227,446 | enrich_references | skos_definition | — | [] | Merged ChEBI/PubChem definitions into skos:definition |
| 227,447 | enrich_references | references | [] | [{"@id":"http://jglobal.jst.go.jp/en/redirect?Nikkaji_No=J1.952F","provenance":{"prov:wasGeneratedBy":"enrich_reference… | Added references with provenance; cas_numbers=['1330-78-5']; matched_chebi_ids=[]; candidate_pubchem_cids=[5564, 6527, 6529, 11232, 2724691, 44630431, 57501505, 76961998]; selected_pubchem_cids=[6529, 44630431, 57501505, 76961998]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| 248,392 | rdkit_pre_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | rdkit_pre_consensus from 'CC1=C(C(=CC=C1)O)OP(=O)(OC2=C(C=C(C=C2)O)C)OC3=C(C=CC(=C3)O)C'; added: molecular_mass, monoisotopic_mass |
| 273,109 | consensus_match | altLabel | [] | [{"@value":"Celluflex 179C","@language":"en","source":{"prov:wasGeneratedBy":"consensus_match","prov:wasAttributedTo":"… | group_key=tris(methylphenyl)phosphate||dimension=Environmental > media=Water > water_body=Surface water; cas=1330-78-5; added Common Chemistry CAS names as altLabel: Celluflex 179C, Cresyl phosphate, Disflamoll TKP, Disflamoll TKP-P, Durad 124, Durad 125, Durad TCP, Fyrquel 150, Imol S 140, Kronitex, Kronitex R, Kronitex TCP, Lindol, Lindol XP Plus, MeSH ID: D014317, Nissan Unflame TCP, Phosflex TCP, Phosphlex 179A, Phosphoric acid tricresyl ester, Phosphoric acid, tris(methylphenyl) ester, Phosphoric acid, tritolyl ester, RB 6, Reomol TCP, Sansocizer TCP, Sumiguard TBT, Syn-O-Ad 8484, T 306, T 306 (antiwear agent), TCF, TCP, Tricresol phosphate, Tricresyl orthophosphate, Tricresyl phosphate, Tris(tolyloxy)phosphine oxide, Tritolyl phosphate, WSFR-TCP; object_uuid=fo-06574d9e224fb032 |
| 273,110 | consensus_match | cas_match_labels | — | {"1330-78-5":"exactMatch"} | group_key=tris(methylphenyl)phosphate||dimension=Environmental > media=Water > water_body=Surface water; group_sources=['ec_inventory', 'pubchem']; cas_sources={'1330-78-5': ['ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-06574d9e224fb032: {'1330-78-5': 'exactMatch'} |
| 273,532 | opsin_iupac | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | opsin_iupac: set authoritative IUPAC name, SMILES, InChI from 'Phosphoric acid tricresyl ester' |
| 279,888 | rdkit_post_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | rdkit_post_consensus from 'Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1'; added: molecular_mass, monoisotopic_mass; confirmed: smiles_string, inchi2d_string, inchi2d_key_string, molecular_formula |
| 286,733 | withhold_ambiguous_mass | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C21H21O4P"… | withhold_ambiguous_mass: removed molecular_mass, monoisotopic_mass; the flow carries 4 candidate structures, so no one mass describes it |
| 287,328 | strip_catalogue_altlabels | altLabel | [{"@value":"Celluflex 179C","@language":"en","source":{"prov:wasGeneratedBy":"consensus_match","prov:wasAttributedTo":"… | [{"@value":"Cresyl phosphate","@language":"en","source":{"prov:wasGeneratedBy":"consensus_match","prov:wasAttributedTo"… | Removed 8 catalogue altLabel value(s): 'Celluflex 179C' (trade name), 'Durad 124' (trade name), 'Durad 125' (trade name), 'Fyrquel 150' (trade name), 'Phosphlex 179A' (trade name), 'RB 6' (grade code), 'T 306' (grade code), 'T 306 (antiwear agent)' (grade code) |
| 344,579 | carry_associations_onto_flows | concept_associations | [] | [{"@type":"xkos:ConceptAssociation","xkos:sourceConcept":{"@id":"https://vocab.brightway.one/ef/3.1/flow/82188b29-fc46-… | associations resolved on the elementary layer |
| 394,297 | link_flows_to_their_substance | types | — | ["https://w3id.org/chemrof/NeutralMolecule"] | the substance's answer, copied onto its flow |
PROV-O trail
20 activitiesOne activity per change: which version of the flow it consumed, and which it produced. The values are on the change with the same number — stored once, not twice.
| Activity | Field | Agent | Used | Generated |
|---|---|---|---|---|
| ef:activity/change/20260820T0738569779880000/290 | prefLabel | ef:agent/bootstrap_labels | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v0 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v1 |
| ef:activity/change/20260820T0738569779880000/291 | name | ef:agent/bootstrap_labels | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v1 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v2 |
| ef:activity/change/20260820T0738569779880000/23970 | synonyms | ef:agent/bootstrap_labels | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v2 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v3 |
| ef:activity/change/20260820T0738569779880000/127114 | context | ef:agent/default_context_mapping | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v3 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v4 |
| ef:activity/change/20260820T0738569779880000/127115 | context_iri | ef:agent/default_context_mapping | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v4 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v5 |
| ef:activity/change/20260820T0738569779880000/213435 | unit_iri | ef:agent/unit_normalization | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v5 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v6 |
| ef:activity/change/20260820T0738569779880000/221157 | prefLabel | ef:agent/normalize_name_case | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v6 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v7 |
| ef:activity/change/20260820T0738569779880000/226720 | ec_numbers | ef:agent/ec_cross_check | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v7 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v8 |
| ef:activity/change/20260820T0738569779880000/227445 | properties | ef:agent/enrich_references | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v8 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v9 |
| ef:activity/change/20260820T0738569779880000/227446 | skos_definition | ef:agent/enrich_references | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v9 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v10 |
| ef:activity/change/20260820T0738569779880000/227447 | references | ef:agent/enrich_references | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v10 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v11 |
| ef:activity/change/20260820T0738569779880000/248392 | properties | ef:agent/rdkit_pre_consensus | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v11 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v12 |
| ef:activity/change/20260820T0738569779880000/273109 | altLabel | ef:agent/consensus_match | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v12 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v13 |
| ef:activity/change/20260820T0738569779880000/273110 | cas_match_labels | ef:agent/consensus_match | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v13 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v14 |
| ef:activity/change/20260820T0738569779880000/273532 | properties | ef:agent/opsin_iupac | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v14 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v15 |
| ef:activity/change/20260820T0738569779880000/279888 | properties | ef:agent/rdkit_post_consensus | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v15 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v16 |
| ef:activity/change/20260820T0738569779880000/286733 | properties | ef:agent/withhold_ambiguous_mass | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v16 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v17 |
| ef:activity/change/20260820T0738569779880000/287328 | altLabel | ef:agent/strip_catalogue_altlabels | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v17 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v18 |
| ef:activity/change/20260820T0738569779880000/344579 | concept_associations | ef:agent/carry_associations_onto_flows | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v18 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v19 |
| ef:activity/change/20260820T0738569779880000/394297 | types | ef:agent/link_flows_to_their_substance | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v19 | ef:flow/82188b29-fc46-4322-ad02-809450df75d8/v20 |