Clopyralid-olamine
97f1162c84f8f6b5f151b48bca1e448262e26691
Identity
- Substance
- fo-3abfe8698d56240f MolecularComplex
- Source
- ecoinvent algorithm addition
- Unit
- kg
- Context
- Environmental → Ground → Silvicultural
- CAS
- 57754-85-5
- EC
- 260-929-4
Context
- Dimension
- Environmental
- Geography
- Silvicultural
- Media
- Ground
Alternative labels
9- 2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)
- Clopyr AG
- Clopyralid monoethanolamine salt
- Clopyralid olamine
- Cyronal
- Dowco 290 monoethanolamine salt
- Ethanol, 2-amino-, 3,6-dichloro-2-pyridinecarboxylate (salt)
- Lontrel Turf and Ornamental
- Reclaim
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| ecoinvent | 3.12 | 089be125-ae83-5cb0-84f1-74d05b62cdb0 | Clopyralid-olamine | Nothing in the list carried this substance, so this flow was created from this row. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| ecoinvent 3.12 | 089be125-ae83-5cb0-84f1-74d05b62cdb0 | Clopyralid-olamine | soil / forestry | exactMatch | — |
History
The change log and the PROV-O trail (0 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"uuid": "97f1162c84f8f6b5f151b48bca1e448262e26691",
"identifier": "",
"name": "Clopyralid-olamine",
"source": "ecoinvent algorithm addition",
"cas_numbers": [
"57754-85-5"
],
"ec_numbers": [
"260-929-4"
],
"context": {
"dimension": "Environmental",
"media": "Ground",
"geography": "Silvicultural"
},
"synonyms": [],
"lcia_methods": [],
"unit": "kg",
"input_datasets": [],
"prefLabel": [
{
"@value": "Clopyralid-olamine",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent-3.12"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"altLabel": [
{
"@value": "2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Clopyr AG",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Clopyralid monoethanolamine salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Clopyralid olamine",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cyronal",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dowco 290 monoethanolamine salt",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Ethanol, 2-amino-, 3,6-dichloro-2-pyridinecarboxylate (salt)",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Lontrel Turf and Ornamental",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Reclaim",
"@language": "en",
"@lang": "en",
"provenance": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:57754-85-5",
"ecoinvent-3.12",
"https://commonchemistry.cas.org/detail?cas_rn=57754-85-5"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-grou-silv",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-3abfe8698d56240f",
"properties": {
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)"
]
},
"attested_by": {
"2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)": [
"opsin_iupac"
]
}
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
}
],
"attested_by": {
"NCCO.O=C(O)c1nc(Cl)ccc1Cl": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C6H3Cl2NO2.C2H7NO/c7-3-1-2-4(8)9-5(3)6(10)11;3-1-2-4/h1-2H,(H,10,11);4H,1-3H2"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"2-Pyridinecarboxylic acid, 3,6-dichloro-, compd. with 2-aminoethanol (1:1)"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
}
],
"attested_by": {
"InChI=1S/C6H3Cl2NO2.C2H7NO/c7-3-1-2-4(8)9-5(3)6(10)11;3-1-2-4/h1-2H,(H,10,11);4H,1-3H2": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"rdfs:label": "InChIKey",
"@value": [
"NQQBTWVFKDDVIB-UHFFFAOYSA-N"
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
},
"attested_by": {
"NQQBTWVFKDDVIB-UHFFFAOYSA-N": [
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"rdfs:label": "Molecular formula",
"@value": [
"C8H10Cl2N2O3"
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
},
"attested_by": {
"C8H10Cl2N2O3": [
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
253.085
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
},
"attested_by": {
"253.085": [
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
252.006848
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"NCCO.O=C(O)c1nc(Cl)ccc1Cl"
]
},
"attested_by": {
"252.006848": [
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=57754-85-5",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"57754-85-5"
],
"prov:wasDerivedFrom": "cas_numbers"
}
}
],
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ecoinvent/3.12/flow/089be125-ae83-5cb0-84f1-74d05b62cdb0",
"skos:prefLabel": "Clopyralid-olamine",
"context": "soil / forestry",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/97f1162c84f8f6b5f151b48bca1e448262e26691"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/97f1162c84f8f6b5f151b48bca1e448262e26691"
},
"provenance": {
"prov:wasGeneratedBy": "merge_ecoinvent",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"ecoinvent:3.12:089be125-ae83-5cb0-84f1-74d05b62cdb0",
"Clopyralid-olamine",
"ecoinvent-3.11-biosphere-EF-3.1-biosphere"
],
"prov:wasDerivedFrom": "flow_object_creation:no-flow-object-candidate"
}
}
],
"_sources": {},
"cas_match_labels": {},
"general_comment": "",
"_transformed": false,
"_provided": {
"name": null,
"synonyms": [],
"context": [],
"cas_numbers": [],
"ec_numbers": [],
"unit": null
},
"elementary_flow_id": "97f1162c84f8f6b5f151b48bca1e448262e26691",
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
]
}