Perfluorocyclopentene
a19bc252-e251-11e6-bf01-fe55135034f3
Identity
- Substance
- fo-4579bb4e56dee840 NeutralMolecule
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile)
- CAS
- 559-40-0
- EC
- 209-203-0
Context
- Dimension
- Environmental
- Media
- Air
- Population density
- Rural (<1000 people/square mile)
- Strata
- Medium stack, <150 meters
Alternative labels
8- 1,2,3,3,4,4,5,5-Octafluoro-1-cyclopentene
- 1,2,3,3,4,4,5,5-Octafluorocyclopentene
- Cyclopentene, 1,2,3,3,4,4,5,5-octafluoro-
- Cyclopentene, octafluoro-
- Flon C 1418
- Fron C 1418
- Octafluorocyclopentene
- Zeorora ZFL 58
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | a19bc252-e251-11e6-bf01-fe55135034f3 | Perfluorocyclopentene | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | a19bc252-e251-11e6-bf01-fe55135034f3 | Perfluorocyclopentene | Emissions/Emissions to air/Emissions to non-urban air or from high stacks | exactMatch | — |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "1,2,3,3,4,4,5,5-Octafluoro-1-cyclopentene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "1,2,3,3,4,4,5,5-Octafluorocyclopentene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cyclopentene, 1,2,3,3,4,4,5,5-octafluoro-",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Cyclopentene, octafluoro-",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Flon C 1418",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Fron C 1418",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Octafluorocyclopentene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Zeorora ZFL 58",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:559-40-0",
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Perfluorocyclopentene"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Perfluorocyclopentene"
]
},
"attested_by": {
"Perfluorocyclopentene": [
"opsin_iupac"
]
}
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Perfluorocyclopentene"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
}
],
"attested_by": {
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C5F8/c6-1-2(7)4(10,11)5(12,13)3(1,8)9"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Perfluorocyclopentene"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
}
],
"attested_by": {
"InChI=1S/C5F8/c6-1-2(7)4(10,11)5(12,13)3(1,8)9": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"rdfs:label": "InChIKey",
"@value": [
"YBMDPYAEZDJWNY-UHFFFAOYSA-N"
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
},
"attested_by": {
"YBMDPYAEZDJWNY-UHFFFAOYSA-N": [
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"rdfs:label": "Molecular formula",
"@value": [
"C5F8"
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
},
"attested_by": {
"C5F8": [
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
212.039
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
},
"attested_by": {
"212.039": [
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
211.987226
],
"provenance": {
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"FC1=C(F)C(F)(F)C(F)(F)C1(F)F"
]
},
"attested_by": {
"211.987226": [
"rdkit_post_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=559-40-0",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.consensus_cas_link",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"559-40-0"
],
"prov:wasDerivedFrom": "cas_numbers"
}
}
],
"prefLabel": [
{
"@value": "Perfluorocyclopentene",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/NeutralMolecule"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "a19bc252-e251-11e6-bf01-fe55135034f3",
"identifier": "a19bc252-e251-11e6-bf01-fe55135034f3",
"source": "EF 3.1",
"cas_numbers": [
"559-40-0"
],
"ec_numbers": [
"209-203-0"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Medium stack, <150 meters",
"population_density": "Rural (<1000 people/square mile)"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "6209b35f-9447-40b5-b68c-a1099e3674a0",
"name": "Climate change",
"methodology": "Environmental Footprint",
"impact_category": "Climate change",
"impact_indicator": "Radiative forcing as Global Warming Potential (GWP100)",
"characterization_factor": 78.1
},
{
"method_uuid": "7fce5b3a-66b8-4ce1-91e8-a925aee1f186",
"name": "Climate change-Fossil",
"methodology": "Environmental Footprint",
"impact_category": "Climate change",
"impact_indicator": "Radiative forcing as Global Warming Potential (GWP100)",
"characterization_factor": 78.1
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-mest15me-ru10pesq",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-4579bb4e56dee840",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/a19bc252-e251-11e6-bf01-fe55135034f3",
"skos:prefLabel": "Perfluorocyclopentene",
"context": "Emissions/Emissions to air/Emissions to non-urban air or from high stacks",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/a19bc252-e251-11e6-bf01-fe55135034f3"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/a19bc252-e251-11e6-bf01-fe55135034f3"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "bootstrap_labels",
"name": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"cas_numbers": "commonchem_cas_review",
"cas_number_sources": "commonchem_cas_review",
"ec_numbers": "ec_cross_check",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "consensus_match",
"cas_match_labels": "consensus_match",
"properties": "normalise_property_values",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"559-40-0": "exactMatch"
},
"cas_number_sources": {
"559-40-0": {
"prov:wasGeneratedBy": "commonchem_cas_review",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://commonchemistry.cas.org/detail?cas_rn=559-40-0"
],
"prov:wasDerivedFrom": "Common Chemistry exact-name CAS fill-in"
}
},
"_transformed": true,
"_provided": {
"name": "Perfluorocyclopentene",
"synonyms": [],
"context": [
"Emissions",
"Emissions to air",
"Emissions to non-urban air or from high stacks"
],
"cas_numbers": [],
"ec_numbers": [],
"unit": "kg"
}
}