Sodium Pentachlorophenolate
d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08
Identity
- Substance
- fo-e1a3ff255ce1f181 Molecular complex
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Air → Medium stack, <150 meters → Rural (<1000 people/square mile)
- CAS
- 131-52-2
- EC
- 205-025-2
Context
- Dimension
- Environmental
- Media
- Air
- Population density
- Rural (<1000 people/square mile)
- Strata
- Medium stack, <150 meters
Alternative labels
25- Biocel WD
- Dowicide G
- GR 48-11PS
- GR 48-32S
- Mystox D
- NAPCP
- PCP sodium salt
- PCP-Na
- PCP-Sodium
- PKhFN
- Pentachlorophenate sodium
- Pentachlorophenol sodium salt
- Pentachlorophenoxy sodium
- Pentanot 25
- Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1)
- Phenol, pentachloro-, sodium deriv.
- Phenol, pentachloro-, sodium salt
- Preventol PN
- Santobrite
- Sapco 25
- Sodium PCP
- Sodium pentachlorophenate
- Sodium pentachlorophenol
- Sodium pentachlorophenoxide
- Witophen N
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08 | sodium pentachlorophenolate | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08 | sodium pentachlorophenolate | Emissions/Emissions to air/Emissions to non-urban air or from high stacks | exactMatch | — |
Characterisation factors
4- consensus-flow-list 2
- European Commission — JRC 2
Every implementation that says anything about this flow. Published as is what this list did with the row: where more than one implementation states a number and they agree it publishes it as agreed; where only one speaks, as sole; where they disagree it publishes nothing and asks.
| Method | Implementation | Category | Place | Factor | Published as |
|---|---|---|---|---|---|
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater | — | 124,280 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater | — | 124,280 | sole |
| EF 3.1 | European Commission — JRC | Ecotoxicity, freshwater_organics | — | 124,280 | — |
| EF 3.1 | consensus-flow-list | Ecotoxicity, freshwater_organics | — | 124,280 | sole |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "Biocel WD",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Dowicide G",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "GR 48-11PS",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "GR 48-32S",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Mystox D",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "NAPCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "PCP sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "PCP-Na",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "PCP-Sodium",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "PKhFN",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Pentachlorophenate sodium",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Pentachlorophenol sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Pentachlorophenoxy sodium",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Pentanot 25",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phenol, pentachloro-, sodium deriv.",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Phenol, pentachloro-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Preventol PN",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Santobrite",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sapco 25",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium PCP",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium pentachlorophenate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium pentachlorophenol",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium pentachlorophenoxide",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Witophen N",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:131-52-2",
"https://commonchemistry.cas.org/detail?cas_rn=131-52-2"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C6HCl5NaO"
],
"attested_by": {
"C6HCl5NaO": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"LOPOPQQQPNEPQF-UHFFFAOYSA-N"
],
"attested_by": {
"LOPOPQQQPNEPQF-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"@value": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
],
"attested_by": {
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "SMILES",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549"
],
"prov:wasDerivedFrom": "pubchem.props.SMILES"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"@value": [
"InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;"
],
"attested_by": {
"InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;": [
"enrich_references.pubchem_semantic",
"rdkit_post_consensus"
]
},
"rdfs:label": "InChI",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549"
],
"prov:wasDerivedFrom": "pubchem.props.InChI"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
]
},
"https://w3id.org/chemrof/molecular_mass": {
"@id": "https://w3id.org/chemrof/molecular_mass",
"rdfs:label": "Molecular mass",
"@value": [
289.328
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
],
"attested_by": {
"289.328": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
},
"https://w3id.org/chemrof/monoisotopic_mass": {
"@id": "https://w3id.org/chemrof/monoisotopic_mass",
"rdfs:label": "Monoisotopic mass",
"@value": [
286.836772
],
"provenance": [
{
"prov:wasGeneratedBy": "rdkit_pre_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O.[Na]"
]
}
],
"attested_by": {
"286.836772": [
"rdkit_post_consensus",
"rdkit_pre_consensus"
]
},
"http://qudt.org/schema/qudt/hasUnit": "https://vocab.brightway.one/units/unit/GM-PER-MOL"
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=131-52-2",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549;CAS:131-52-2"
],
"prov:wasDerivedFrom": "pubchem.identifiers[131-52-2]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/87060549",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:87060549;CAS:131-52-2"
],
"prov:wasDerivedFrom": "pubchem.by_cas[131-52-2]"
}
}
],
"prefLabel": [
{
"@value": "Sodium Pentachlorophenolate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/MolecularComplex"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08",
"identifier": "d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08",
"source": "EF 3.1",
"cas_numbers": [
"131-52-2"
],
"ec_numbers": [
"205-025-2"
],
"context": {
"dimension": "Environmental",
"media": "Air",
"strata": "Medium stack, <150 meters",
"population_density": "Rural (<1000 people/square mile)"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 124280.0
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 124280.0
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-air-mest15me-ru10pesq",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-e1a3ff255ce1f181",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08",
"skos:prefLabel": "sodium pentachlorophenolate",
"context": "Emissions/Emissions to air/Emissions to non-urban air or from high stacks",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/d5e69cb6-f533-42c1-a2e4-5ee9fcc96f08"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "normalise_property_values",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "strip_catalogue_altlabels",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"131-52-2": "exactMatch"
},
"general_comment": "Correct mapping CAS and flow to be verified: yet unclear whether this is the sodium-, hydrochloride-, calcium-, potassium- or other salt or the pure substance that is emitted. Note that the CAS No is the relevant identifier, to which also the ILCD LCIA characterisation factors relate. Reference elementary flow of the International Reference Life Cycle Data System (ILCD).",
"_transformed": true,
"_provided": {
"name": "sodium pentachlorophenolate",
"synonyms": [
"1-Hydroxy-2,3,4,5,6-pentachlorobenzene",
"1-Hydroxypentachlorobenzene",
"1y4z",
"2,3,4,5,6-Pentachlorophenol",
"2,3,4,5,6-Pentachlorophenol (Dowicide EC-7)",
"2,3,4,5,6-Pentachlorophenol, technical grade",
"AC-11105",
"AC1L1AHN",
"AC1Q2AJG",
"AC1Q78BF",
"AD 73",
"AKOS001075639",
"CM 613",
"CP 1309",
"Chem-Penta",
"Chem-Tol",
"Chlon",
"Chlorophen",
"Dow pentachlorophenol DP-2 antimicrobial",
"Dowcide 7",
"Dowicide 7",
"Dowicide 7 Antimicrobial",
"Dowicide EC-7",
"Dura Treet II",
"Dura-Treet",
"Durotox",
"EP 30",
"EP 30 (pesticide)",
"Forepen",
"Forpen-50 Wood Preservative",
"Fungifen",
"Glazd penta",
"Grundier arbezol",
"Lauxtol",
"Lauxtol A",
"Liroprem",
"MB 333",
"NCI-C54933",
"NCI-C55378",
"NCI-C55389",
"NCI-C56655",
"NCI60_003902",
"Ontrack WE Herbicide",
"Ortho Triox Liquid Vegetation Killer",
"Osmoplastic",
"Osmose Wood Preserving Compound",
"Oz-88",
"P0033",
"PCP (pesticide)",
"PENTA",
"Penchlorol",
"Penta Concentrate",
"Penta ready",
"Penta wr",
"Penta-Kil",
"Pentachloorfenol",
"Pentachlorofenol",
"Pentachlorophenate",
"Pentachlorophenate, Sodium",
"Pentachlorophenol [BSI:ISO]",
"Pentachlorophenol [Polychlorophenols and their sodium salts]",
"Pentachlorophenol pure",
"Pentachlorophenol, dowicide ec-7",
"Pentachlorophenol, dp-2",
"Pentachlorophenol, purified",
"Pentachlorophenol, technical",
"Pentachlorphenol",
"Pentaclorofenolo",
"Pentacon",
"Penwar",
"Peratox",
"Permacide",
"Permagard",
"Permasan",
"Permatox",
"Permatox DP-2",
"Permatox penta",
"Permite",
"Phenol, 2,3,4,5,6-pentachloro-",
"Phenol, pentachloro-",
"Phenol, pentachloro-, pure",
"Pol Nu",
"Pol-NU",
"Pole topper fluid",
"Preventol P",
"Priltox",
"QTL1_000066",
"Rcra waste number U242",
"SGCUT00104",
"SMR000471858",
"Santobrite",
"Santophen 20",
"Sinituho",
"Sodium pentachlorophenate",
"SpecPlus_000514",
"TRANSGENIC LECM (PENTACHLOROPHENOL) (SEE ALSOPENTACHLOROPHENOL)",
"Term-i-trol",
"Thompson's wood fix",
"Watershed Wood Preservative",
"Weed and Brush Killer",
"Witophen P",
"Woodtreat A",
"cryptogil oil",
"lauxt ol",
"pentachloro(1-14c)phenol",
"pentachloro-Phenol",
"pentachlorophenol",
"pentachlorophenol dp-2",
"to_000075"
],
"context": [
"Emissions",
"Emissions to air",
"Emissions to non-urban air or from high stacks"
],
"cas_numbers": [
"131-52-2"
],
"ec_numbers": [
"205-025-2"
],
"unit": "kg"
}
}