Perfluoropropane
Everything that changed this flow. Back to the flow
e2fadda5-6555-11dd-ad8b-0800200c9a66
By field
14 fields| Field | Changes | Written by | Latest note |
|---|---|---|---|
| properties | 6 | enrich_references, link_flows_to_their_substance, normalise_property_values, opsin_iupac, rdkit_post_consensus, rdkit_pre_consensus | the substance's answer, copied onto its flow |
| altLabel | 3 | chebi_altlabels, consensus_match, strip_catalogue_altlabels | Removed 13 catalogue altLabel value(s): 'DMP 115' (grade code), 'F 218' (grade code), 'FC 218' (grade code), 'FC 218 (refrigerant)' (grade code), 'FS 069' (grade code), 'HFC 218' (grade code), 'Khladon 218' (trade name), 'MRH 815H' (grade code), 'MRX 115' (grade code), 'Meforex 218' (trade name), 'PFC 218' (grade code), 'R 218' (grade code), 'YM 454' (grade code) |
| prefLabel | 2 | bootstrap_labels, normalize_name_case | Title-cased words without internal capitals (preserved words with uppercase letters beyond the first character) |
| cas_match_labels | 1 | consensus_match | group_key=perfluoropropane||dimension=Environmental > media=Air > strata=Unknown; group_sources=['chebi', 'ec_inventory', 'pubchem']; cas_sources={'76-19-7': ['chebi', 'ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-f67493e282213bda: {'76-19-7': 'exactMatch'} |
| concept_associations | 1 | carry_associations_onto_flows | associations resolved on the elementary layer |
| context | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to sea water |
| context_iri | 1 | default_context_mapping | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to sea water |
| ec_numbers | 1 | ec_cross_check | Resolved from EC-inventory: 200-941-9 from CAS 76-19-7 |
| name | 1 | bootstrap_labels | Purged legacy name field to enforce prefLabel usage |
| references | 1 | enrich_references | Added references with provenance; cas_numbers=['76-19-7']; matched_chebi_ids=['http://purl.obolibrary.org/obo/CHEBI_31980']; candidate_pubchem_cids=[6432]; selected_pubchem_cids=[6432]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| skos_definition | 1 | enrich_references | Merged ChEBI/PubChem definitions into skos:definition |
| synonyms | 1 | bootstrap_labels | Removed legacy synonyms field in favor of structured labels |
| types | 1 | link_flows_to_their_substance | the substance's answer, copied onto its flow |
| unit_iri | 1 | unit_normalization | Unit IRI set from normalization of 'kg' |
Where several steps wrote one field, the last one won — and the log below shows the sequence.
Changes
22| # | Step | Field | From | To | Why |
|---|---|---|---|---|---|
| 7,995 | bootstrap_labels | prefLabel | — | [{"@value":"perfluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttributedTo… | Bootstrapped prefLabel from legacy name field |
| 7,996 | bootstrap_labels | name | perfluoropropane | — | Purged legacy name field to enforce prefLabel usage |
| 7,997 | bootstrap_labels | synonyms | ["1,1,1,2,2,3,3,3-Octafluoropropane","AC1L1MIR","AC1Q4IBX","DMP 115","DMP-115","Definity","Definity (TN)","FC 218","FC… | [] | Removed legacy synonyms field in favor of structured labels |
| 185,268 | default_context_mapping | context | — | {"dimension":"Environmental","media":"Water","water_body":"Ocean"} | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to sea water |
| 185,269 | default_context_mapping | context_iri | — | https://vocab.brightway.one/flow-contexts/envi-wate-ocea | Mapped from context mapping for source=EF 3.1, source context Emissions > Emissions to water > Emissions to sea water |
| 216,006 | unit_normalization | unit_iri | — | https://vocab.brightway.one/units/unit/KiloGM | Unit IRI set from normalization of 'kg' |
| 222,977 | normalize_name_case | prefLabel | [{"@value":"perfluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttributedTo… | [{"@value":"Perfluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"bootstrap_labels","prov:wasAttributedTo… | Title-cased words without internal capitals (preserved words with uppercase letters beyond the first character) |
| 226,871 | ec_cross_check | ec_numbers | [] | ["200-941-9"] | Resolved from EC-inventory: 200-941-9 from CAS 76-19-7 |
| 234,823 | enrich_references | properties | {} | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | Added ChEBI/PubChem properties (chebi_ids=1, pubchem_cids=1) |
| 234,824 | enrich_references | skos_definition | — | [{"@value":"A fluorocarbon that is propane in which all of the hydrogens have been replaced by fluorines.","@language":… | Merged ChEBI/PubChem definitions into skos:definition |
| 234,825 | enrich_references | references | [] | [{"@id":"beilstein:1704032","provenance":{"prov:wasGeneratedBy":"enrich_references.chebi_xrefs","prov:wasAttributedTo":… | Added references with provenance; cas_numbers=['76-19-7']; matched_chebi_ids=['http://purl.obolibrary.org/obo/CHEBI_31980']; candidate_pubchem_cids=[6432]; selected_pubchem_cids=[6432]; formula_similarity_expected=[]; pubchem_selection_rule=curated_cas_then_formula_similarity_then_prefer_chebi_aligned_when_unambiguous_else_keep_all_cas_matches; single_cas_commonchem_link=yes |
| 250,506 | rdkit_pre_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | rdkit_pre_consensus from 'C(C(F)(F)F)(C(F)(F)F)(F)F'; added: monoisotopic_mass |
| 255,481 | chebi_altlabels | altLabel | [] | [{"@value":"1,1,1,2,2,3,3,3-octafluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov… | Added 8 ChEBI synonym(s) as altLabel from 1 linked ChEBI record(s) |
| 270,521 | consensus_match | altLabel | [{"@value":"1,1,1,2,2,3,3,3-octafluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov… | [{"@value":"1,1,1,2,2,3,3,3-octafluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov… | group_key=perfluoropropane||dimension=Environmental > media=Air > strata=Unknown; cas=76-19-7; added Common Chemistry CAS names as altLabel: DMP 115, F 218, FC 218 (refrigerant), FS 069, Genetron 218, HFC 218, Khladon 218, MRH 815H, MRX 115, Meforex 218, Optison, PFC 218, Propane, 1,1,1,2,2,3,3,3-octafluoro-, Propane, octafluoro-, R 218, YM 454; object_uuid=fo-f67493e282213bda |
| 270,523 | consensus_match | cas_match_labels | — | {"76-19-7":"exactMatch"} | group_key=perfluoropropane||dimension=Environmental > media=Air > strata=Unknown; group_sources=['chebi', 'ec_inventory', 'pubchem']; cas_sources={'76-19-7': ['chebi', 'ec_inventory', 'pubchem']}; assigned CAS labels from group consensus; object_uuid=fo-f67493e282213bda: {'76-19-7': 'exactMatch'} |
| 275,675 | opsin_iupac | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | opsin_iupac: set authoritative IUPAC name, SMILES, InChI from 'Perfluoropropane' |
| 282,220 | rdkit_post_consensus | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | rdkit_post_consensus from 'FC(F)(F)C(F)(F)C(F)(F)F'; confirmed: smiles_string, inchi2d_string, inchi2d_key_string, molecular_formula, molecular_mass, monoisotopic_mass |
| 288,897 | strip_catalogue_altlabels | altLabel | [{"@value":"1,1,1,2,2,3,3,3-octafluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov… | [{"@value":"1,1,1,2,2,3,3,3-octafluoropropane","@language":"en","source":{"prov:wasGeneratedBy":"chebi_altlabels","prov… | Removed 13 catalogue altLabel value(s): 'DMP 115' (grade code), 'F 218' (grade code), 'FC 218' (grade code), 'FC 218 (refrigerant)' (grade code), 'FS 069' (grade code), 'HFC 218' (grade code), 'Khladon 218' (trade name), 'MRH 815H' (grade code), 'MRX 115' (grade code), 'Meforex 218' (trade name), 'PFC 218' (grade code), 'R 218' (grade code), 'YM 454' (grade code) |
| 373,661 | carry_associations_onto_flows | concept_associations | [] | [{"@type":"xkos:ConceptAssociation","xkos:sourceConcept":{"@id":"https://vocab.brightway.one/ef/3.1/flow/e2fadda5-6555-… | associations resolved on the elementary layer |
| 390,008 | normalise_property_values | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | typed the way the ontology types it |
| 397,437 | link_flows_to_their_substance | types | — | ["https://w3id.org/chemrof/NeutralMolecule"] | the substance's answer, copied onto its flow |
| 397,438 | link_flows_to_their_substance | properties | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | {"https://w3id.org/chemrof/molecular_formula":{"@id":"https://w3id.org/chemrof/molecular_formula","@value":["C3F8"],"at… | the substance's answer, copied onto its flow |
PROV-O trail
22 activitiesOne activity per change: which version of the flow it consumed, and which it produced. The values are on the change with the same number — stored once, not twice.
| Activity | Field | Agent | Used | Generated |
|---|---|---|---|---|
| ef:activity/change/20260822T0600486828500000/7995 | prefLabel | ef:agent/bootstrap_labels | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v0 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v1 |
| ef:activity/change/20260822T0600486828500000/7996 | name | ef:agent/bootstrap_labels | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v1 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v2 |
| ef:activity/change/20260822T0600486828500000/7997 | synonyms | ef:agent/bootstrap_labels | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v2 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v3 |
| ef:activity/change/20260822T0600486828500000/185268 | context | ef:agent/default_context_mapping | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v3 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v4 |
| ef:activity/change/20260822T0600486828500000/185269 | context_iri | ef:agent/default_context_mapping | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v4 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v5 |
| ef:activity/change/20260822T0600486828500000/216006 | unit_iri | ef:agent/unit_normalization | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v5 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v6 |
| ef:activity/change/20260822T0600486828500000/222977 | prefLabel | ef:agent/normalize_name_case | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v6 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v7 |
| ef:activity/change/20260822T0600486828500000/226871 | ec_numbers | ef:agent/ec_cross_check | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v7 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v8 |
| ef:activity/change/20260822T0600486828500000/234823 | properties | ef:agent/enrich_references | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v8 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v9 |
| ef:activity/change/20260822T0600486828500000/234824 | skos_definition | ef:agent/enrich_references | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v9 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v10 |
| ef:activity/change/20260822T0600486828500000/234825 | references | ef:agent/enrich_references | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v10 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v11 |
| ef:activity/change/20260822T0600486828500000/250506 | properties | ef:agent/rdkit_pre_consensus | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v11 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v12 |
| ef:activity/change/20260822T0600486828500000/255481 | altLabel | ef:agent/chebi_altlabels | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v12 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v13 |
| ef:activity/change/20260822T0600486828500000/270521 | altLabel | ef:agent/consensus_match | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v13 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v14 |
| ef:activity/change/20260822T0600486828500000/270523 | cas_match_labels | ef:agent/consensus_match | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v14 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v15 |
| ef:activity/change/20260822T0600486828500000/275675 | properties | ef:agent/opsin_iupac | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v15 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v16 |
| ef:activity/change/20260822T0600486828500000/282220 | properties | ef:agent/rdkit_post_consensus | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v16 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v17 |
| ef:activity/change/20260822T0600486828500000/288897 | altLabel | ef:agent/strip_catalogue_altlabels | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v17 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v18 |
| ef:activity/change/20260822T0600486828500000/373661 | concept_associations | ef:agent/carry_associations_onto_flows | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v18 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v19 |
| ef:activity/change/20260822T0600486828500000/390008 | properties | ef:agent/normalise_property_values | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v19 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v20 |
| ef:activity/change/20260822T0600486828500000/397437 | types | ef:agent/link_flows_to_their_substance | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v20 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v21 |
| ef:activity/change/20260822T0600486828500000/397438 | properties | ef:agent/link_flows_to_their_substance | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v21 | ef:flow/e2fadda5-6555-11dd-ad8b-0800200c9a66/v22 |