Sodium Chloroacetate
f43a41d7-8f53-4d8e-b646-a44c197ec76c
Identity
- Substance
- fo-548a9e5ab35453b0 ChemicalSalt
- Source
- EF 3.1
- Unit
- kg
- Context
- Environmental → Water → Ocean
- CAS
- 3926-62-3
- EC
- 223-498-3
Context
- Dimension
- Environmental
- Media
- Water
- Water body
- Ocean
Alternative labels
11- Acetic acid, 2-chloro-, sodium salt (1:1)
- Acetic acid, chloro-, sodium salt
- Chloroacetic acid sodium salt
- Monochloroacetic acid sodium salt
- SMA
- SMA (herbicide)
- Sodium 2-chloroacetate
- Sodium chloroethanoate
- Sodium monochloroacetate
- Sodium monochloroactetate
- Sodium α-chloroacetate
Source lists
1| List | Version | Source flow | Name there | Why this flow |
|---|---|---|---|---|
| EF | 3.1 | f43a41d7-8f53-4d8e-b646-a44c197ec76c | sodium chloroacetate | The consensus list is built from this one, so this row is the flow itself rather than something matched to it. |
Concept associations
1| Source list | Source flow | Name there | Compartment there | Match | Conversion |
|---|---|---|---|---|---|
| EF 3.1 | f43a41d7-8f53-4d8e-b646-a44c197ec76c | sodium chloroacetate | Emissions/Emissions to water/Emissions to sea water | exactMatch | — |
History
The change log and the PROV-O trail (2 consensus changes)
These are the heaviest sections of this page and the least often read, so the page does not pay for them until you ask.
Full record
Flow JSON
{
"altLabel": [
{
"@value": "Acetic acid, 2-chloro-, sodium salt (1:1)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Acetic acid, chloro-, sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Chloroacetic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Monochloroacetic acid sodium salt",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SMA",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "SMA (herbicide)",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium 2-chloroacetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium chloroethanoate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium monochloroacetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium monochloroactetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
},
{
"@value": "Sodium α-chloroacetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "consensus_match",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CAS:3926-62-3",
"https://commonchemistry.cas.org/detail?cas_rn=3926-62-3"
],
"prov:wasDerivedFrom": "common chemistry CAS lookup"
}
}
],
"properties": {
"https://w3id.org/chemrof/molecular_formula": {
"@id": "https://w3id.org/chemrof/molecular_formula",
"@value": [
"C2H2ClNaO2",
"C2H3ClNaO2"
],
"attested_by": {
"C2H3ClNaO2": [
"enrich_references.pubchem_semantic"
],
"C2H2ClNaO2": [
"rdkit_post_consensus"
]
},
"rdfs:label": "Molecular formula",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051746"
],
"prov:wasDerivedFrom": "pubchem.props.Molecular Formula"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C([O-])CCl.[Na+]"
]
}
]
},
"https://w3id.org/chemrof/inchi2d_key_string": {
"@id": "https://w3id.org/chemrof/inchi2d_key_string",
"@value": [
"ATACSYDDCNWCLV-UHFFFAOYSA-N",
"FDRCDNZGSXJAFP-UHFFFAOYSA-M"
],
"attested_by": {
"ATACSYDDCNWCLV-UHFFFAOYSA-N": [
"enrich_references.pubchem_semantic"
],
"FDRCDNZGSXJAFP-UHFFFAOYSA-M": [
"rdkit_post_consensus"
]
},
"rdfs:label": "InChIKey",
"provenance": [
{
"prov:wasGeneratedBy": "enrich_references.pubchem_semantic",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051746"
],
"prov:wasDerivedFrom": "pubchem.props.InChIKey"
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C([O-])CCl.[Na+]"
]
}
]
},
"https://w3id.org/chemrof/smiles_string": {
"@id": "https://w3id.org/chemrof/smiles_string",
"rdfs:label": "SMILES",
"@value": [
"O=C([O-])CCl.[Na+]"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium Chloroacetate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C([O-])CCl.[Na+]"
]
}
],
"attested_by": {
"O=C([O-])CCl.[Na+]": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/inchi2d_string": {
"@id": "https://w3id.org/chemrof/inchi2d_string",
"rdfs:label": "InChI",
"@value": [
"InChI=1S/C2H3ClO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1"
],
"provenance": [
{
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium Chloroacetate"
]
},
{
"prov:wasGeneratedBy": "rdkit_post_consensus",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"O=C([O-])CCl.[Na+]"
]
}
],
"attested_by": {
"InChI=1S/C2H3ClO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1": [
"opsin_iupac",
"rdkit_post_consensus"
]
}
},
"https://w3id.org/chemrof/IUPAC_name": {
"@id": "https://w3id.org/chemrof/IUPAC_name",
"rdfs:label": "IUPAC name",
"@value": [
"Sodium Chloroacetate"
],
"provenance": {
"prov:wasGeneratedBy": "opsin_iupac",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"Sodium Chloroacetate"
]
},
"attested_by": {
"Sodium Chloroacetate": [
"opsin_iupac"
]
}
}
},
"references": [
{
"@id": "https://commonchemistry.cas.org/detail?cas_rn=3926-62-3",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_identifier_url",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051746;CAS:3926-62-3"
],
"prov:wasDerivedFrom": "pubchem.identifiers[3926-62-3]"
}
},
{
"@id": "https://pubchem.ncbi.nlm.nih.gov/compound/45051746",
"provenance": {
"prov:wasGeneratedBy": "enrich_references.pubchem_compound",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"CID:45051746;CAS:3926-62-3"
],
"prov:wasDerivedFrom": "pubchem.by_cas[3926-62-3]"
}
}
],
"prefLabel": [
{
"@value": "Sodium Chloroacetate",
"@language": "en",
"source": {
"prov:wasGeneratedBy": "bootstrap_labels",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"EF 3.1"
],
"prov:wasDerivedFrom": "legacy name field"
}
}
],
"@type": [
"https://w3id.org/chemrof/ChemicalSalt"
],
"http://www.w3.org/2004/02/skos/core#definition": [],
"uuid": "f43a41d7-8f53-4d8e-b646-a44c197ec76c",
"identifier": "f43a41d7-8f53-4d8e-b646-a44c197ec76c",
"source": "EF 3.1",
"cas_numbers": [
"3926-62-3"
],
"ec_numbers": [
"223-498-3"
],
"context": {
"dimension": "Environmental",
"media": "Water",
"water_body": "Ocean"
},
"synonyms": [],
"lcia_methods": [
{
"method_uuid": "05316e7a-b254-4bea-9cf0-6bf33eb5c630",
"name": "Ecotoxicity, freshwater",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.0014614
},
{
"method_uuid": "7cfdcfcf-b222-4b26-888a-a55f9fbf7ac8",
"name": "Human toxicity, non-cancer",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 5.0882e-10
},
{
"method_uuid": "8c3141e9-1f15-43b5-bff2-182e49893a46",
"name": "Human toxicity, non-cancer_organics",
"methodology": "Environmental Footprint",
"impact_category": "Non-cancer human health effects",
"impact_indicator": "Comparative Toxic Unit for human (CTUh)",
"characterization_factor": 5.0882e-10
},
{
"method_uuid": "fd530f00-9325-424a-92ef-aaac67922fd9",
"name": "Ecotoxicity, freshwater_organics",
"methodology": "Environmental Footprint",
"impact_category": "Aquatic eco-toxicity",
"impact_indicator": "Comparative Toxic Unit for ecosystems (CTUe) ",
"characterization_factor": 0.0014614
}
],
"unit": "kg",
"input_datasets": [
"EF 3.1"
],
"context_iri": "https://vocab.brightway.one/flow-contexts/envi-wate-ocea",
"unit_iri": "https://vocab.brightway.one/units/unit/KiloGM",
"flow_object_id": "fo-548a9e5ab35453b0",
"concept_associations": [
{
"@type": "xkos:ConceptAssociation",
"xkos:sourceConcept": {
"@id": "https://vocab.brightway.one/ef/3.1/flow/f43a41d7-8f53-4d8e-b646-a44c197ec76c",
"skos:prefLabel": "sodium chloroacetate",
"context": "Emissions/Emissions to water/Emissions to sea water",
"qudt:hasUnit": {
"@id": "https://vocab.brightway.one/units/unit/KiloGM"
},
"skos:exactMatch": {
"@id": "https://vocab.brightway.dev/elementary-flows/f43a41d7-8f53-4d8e-b646-a44c197ec76c"
}
},
"xkos:targetConcept": {
"@id": "https://vocab.brightway.dev/elementary-flows/f43a41d7-8f53-4d8e-b646-a44c197ec76c"
},
"provenance": {
"prov:wasGeneratedBy": "build_concept_associations",
"prov:wasAttributedTo": "consensus-flow-list",
"prov:hadPrimarySource": [
"https://eplca.jrc.ec.europa.eu/permalink/EF3_1/EF-v3.1.zip"
]
}
}
],
"_sources": {
"prefLabel": "normalize_name_case",
"name": "bootstrap_labels",
"synonyms": "bootstrap_labels",
"context": "default_context_mapping",
"context_iri": "default_context_mapping",
"unit_iri": "unit_normalization",
"properties": "withhold_ambiguous_mass",
"skos_definition": "enrich_references",
"references": "enrich_references",
"altLabel": "consensus_match",
"cas_match_labels": "consensus_match",
"concept_associations": "carry_associations_onto_flows",
"types": "link_flows_to_their_substance"
},
"cas_match_labels": {
"3926-62-3": "exactMatch"
},
"general_comment": "Flow does not match ILCD methodology for elementary flows; to be split into the two ions. Flow to be discontinued at next update. Reference elementary flow of the International Reference Life Cycle Data System (ILCD).",
"_transformed": true,
"_provided": {
"name": "sodium chloroacetate",
"synonyms": [
".alpha.-Chloroacetic acid",
"2-chloroacetic acid",
"AB1002140",
"AC1L18XJ",
"AC1Q75JS",
"AC1Q75JT",
"AKOS000118920",
"Acetic acid, 2-chloro-",
"Acetic acid, chloro-",
"Acetocaustin",
"Acetocaustin (TN)",
"Acide chloracetique",
"Acide chloracetique [ISO-French]",
"Acide chloroacetique",
"Acide monochloracetique",
"Acidomonocloroacetico",
"CHLOROACETIC ACID CRYSTALLINE",
"CHLOROACETIC ACID, ACS",
"CHLOROACETIC-ACID",
"Chloracetic acid",
"Chloroacetic",
"Chloroacetic acid [BSI:ISO]",
"Chloroacetic acid, liquid",
"Chloroacetic acid, molten",
"Chloroacetic acid, solid",
"Chloroethanoic acid",
"FOCAUTSVDIKZOP-JLSKMEETCI",
"FOCAUTSVDIKZOP-UHFFFAOYSA-",
"FT-0082724",
"I04-1105",
"Kyselina chloroctova",
"LT00789405",
"Monochloorazijnzuur",
"Monochloracetic acid",
"Monochloracetic acidacide monochloracetique",
"Monochloressigsaeure",
"Monochloroacetic acid",
"Monochloroacetic acid [BSI:ISO]",
"Monochloroethanoic acid",
"NCI-C60231",
"R3W",
"SMR000568484",
"alpha-Chloroacetic acid",
"alpha-chloro-acetic acid",
"chloroacetic acid",
"sJPhLQDIKTp@"
],
"context": [
"Emissions",
"Emissions to water",
"Emissions to sea water"
],
"cas_numbers": [
"3926-62-3"
],
"ec_numbers": [
"223-498-3"
],
"unit": "kg"
}
}