Common Chemistry name differences
Common Chemistry knows this CAS and calls it something else. Nothing was changed: a name is not evidence of identity the way a CAS is, and the flow's own name may be what its source list needs.
commonchem-cas-name-differences
| Severity | Flow | Source | CAS | Common Chemistry calls it | Links |
|---|---|---|---|---|---|
| info | 2,2-dimethylbutyric Acid | EF 3.1 | 595-37-9 | 2,2-Dimethylbutanoic acid | flow |
| info | N,n'-hexane-1,6-diylbis(2-oxoazepane-1-carboxamide) | EF 3.1 | 5888-87-9 | Bruggolen C 20 | flow |
| info | Sodium 4-(4-chloro-o-tolyloxy)butyrate | EF 3.1 | 6062-26-6 | MCPB sodium salt | flow |
| info | N-(2-nitrophenyl)phosphoric Triamide | EF 3.1 | 874819-71-3 | <em>N</em>-(2-Nitrophenyl)phosphoric triamide | flow |
| info | 2,2'-iminodi(ethylamine) | EF 3.1 | 111-40-0 | Diethylenetriamine | flow |
| info | 1-isopropyl-3-methylpyrazol-5-yl Dimethylcarbamate | EF 3.1 | 119-38-0 | Isolan | flow |
| info | Benzo(b)naphtho(1,2-d)thiophene | EF 3.1 | 205-43-6 | Benzo[<em>b</em>]naphtho[1,2-<em>d</em>]thiophene | flow |
| info | 2-amino-1,3-propanediol | EF 3.1 | 534-03-2 | Serinol | flow |
| info | N-isopropyl-2-methylacrylamide | EF 3.1 | 13749-61-6 | <em>N</em>-Isopropylmethacrylamide | flow |
| info | Hydrocarbons, C4, 1,3-butadiene-free, Polymd., Triisobutylene Fraction | EF 3.1 | 91053-01-9 | Hydrocarbons, C<sub>4</sub>, 1,3-butadiene-free, polymd., triisobutylene fraction | flow |
| info | Diethoxy(dimethyl)silane | EF 3.1 | 78-62-6 | Dimethyldiethoxysilane | flow |
| info | 3,4-dichloro-α-(trichloromethyl)benzyl Acetate | EF 3.1 | 21757-82-4 | (±)-Acetofenate | flow |
| info | Esterification Products Of Phosphorus Pentoxide And Alcohols C6-c10 (even Numbered) | EF 3.1 | 68307-94-8 | Phosphoric acid, mono- and di-C<sub>6-10</sub>-alkyl esters | flow |
| info | Reaction Products Of Benzeneamine, N-phenyl- With Nonene (branched) | EF 3.1 | 36878-20-3 | Dinonyldiphenylamine | flow |
| info | Bis(2-ethylhexyl) Cyclohexane-1,4-dicarboxylate | EF 3.1 | 84731-70-4 | 1,4-Bis(2-ethylhexyl) 1,4-cyclohexanedicarboxylate | flow |
| info | N-(n-octyl)-2-pyrrolidinone | EF 3.1 | 2687-94-7 | <em>N</em>-Octylpyrrolidone | flow |
| info | M-tolyl Methylcarbamate | EF 3.1 | 1129-41-5 | Metolcarb | flow |
| info | Chlorfenethol | EF 3.1 | 80-06-8 | 1,1-Bis(4-chlorophenyl)ethanol | flow |
| info | Ethylphenacemide | EF 3.1 | 90-49-3 | Pheneturide | flow |
| info | Sodium 4-(6-ethyldecyl)benzenesulfonate | EF 3.1 | 68608-89-9 | Benzenesulfonic acid, mono-C<sub>11-13</sub>-branched alkyl derivs., sodium salts | flow |
| info | N-butylbenzenesulphonamide | EF 3.1 | 3622-84-2 | <em>N</em>-Butylbenzenesulfonamide | flow |
| info | N,n,n-triethylethanaminium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate | EF 3.1 | 56773-42-3 | Tetraethylammonium perfluorooctanesulfonate | flow |
| info | L-arginine Hydrochloride | EF 3.1 | 1119-34-2 | <span class="text-smallcaps">L</span>-Arginine, monohydrochloride | flow |
| info | O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | EF 3.1 | 18854-01-8 | Isoxathion | flow |
| info | Butanoyl Butanoate | EF 3.1 | 106-31-0 | Butyric anhydride | flow |
| info | Isopropyl 2-bromoisobutyrate | EF 3.1 | 51368-55-9 | 1-Methylethyl 2-bromo-2-methylpropanoate | flow |
| info | Tris(2-ethylhexyl) 2-acetoxypropane-1,2,3-tricarboxylate | EF 3.1 | 144-15-0 | Acetyl tris(2-ethylhexyl) citrate | flow |
| info | 2-phenylethyl Phenylacetate | EF 3.1 | 102-20-5 | Phenylethyl phenylacetate | flow |
| info | Mercury (ii) | EF 3.1 | 14302-87-5 | Mercury(2+) | flow |
| info | 3-hydroxy-7-oxocholan-24-oic Acid | EF 3.1 | 4651-67-6 | 7-Ketolithocholic acid | flow |
| info | Gases (petroleum), Extractive, C3-5, Butene-isobutylene-rich | EF 3.1 | 68477-42-9 | Gases (petroleum), extractive, C<sub>3-5</sub>, butene-isobutylene-rich | flow |
| info | 4-isopropylbenzaldehyde | EF 3.1 | 122-03-2 | Cuminaldehyde | flow |
| info | 2,2,2,o,p'-pentachloroethylidenebisbenzene | EF 3.1 | 789-02-6 | <em>o</em>,<em>p</em>′-DDT | flow |
| info | Docusate Sodium | EF 3.1 | 577-11-7 | Sodium bis(2-ethylhexyl) sulfosuccinate | flow |
| info | Dipotassium Disulphate | EF 3.1 | 7790-62-7 | Potassium pyrosulfate | flow |
| info | N-(hydroxymethyl)-2-methylacrylamide | EF 3.1 | 923-02-4 | Methylolmethacrylamide | flow |
| info | 4-[(4-carbamoylphenyl)diazenyl]-3-hydroxy-n-(2-methoxyphenyl)-2-naphthamide | EF 3.1 | 36968-27-1 | 4-[2-[4-(Aminocarbonyl)phenyl]diazenyl]-3-hydroxy-<em>N</em>-(2-methoxyphenyl)-2-naphthalenecarboxamide | flow |
| info | Copper(2+) Dinitrate | EF 3.1 | 3251-23-8 | Cupric nitrate | flow |
| info | Diisopropyl 3,3'-[(2,5-dichloro-1,4-phenylene)bis[iminocarbonyl(2-hydroxy-3,1-naphthylene)azo]]bis[4-methylbenzoate] | EF 3.1 | 71566-54-6 | 1,1′-Bis(1-methylethyl) 3,3′-[(2,5-dichloro-1,4-phenylene)bis[iminocarbonyl(2-hydroxy-3,1-naphthalenediyl)-2,1-diazened… | flow |
| info | (1r,2s)-2,6-dimethyl-2,3-dihydro-1h-inden-1-amine | EF 3.1 | 752984-24-0 | (1<em>R</em>,2<em>S</em>)-2,3-Dihydro-2,6-dimethyl-1<em>H</em>-inden-1-amine | flow |
| info | 1,2-dichloropropane & 1,3-dichloropropene | EF 3.1 | 8003-19-8 | 1-Propene, 1,3-dichloro-, mixt. with 1,2-dichloropropane | flow |
| info | Sodium 4-(6-ethyldecyl)benzenesulfonate | EF 3.1 | 68608-89-9 | Benzenesulfonic acid, mono-C<sub>11-13</sub>-branched alkyl derivs., sodium salts | flow |
| info | Carbromal | EF 3.1 | 77-65-6 | Hoggar | flow |
| info | N-ethyl-o-toluidine | EF 3.1 | 94-68-8 | <em>N</em>-Ethyl-<em>o</em>-toluidine | flow |
| info | Tris(methylphenyl) Phosphite | EF 3.1 | 25586-42-9 | Phosphorous acid, tris(methylphenyl) ester | flow |
| info | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-n-methyl-, Acetate (1:1) | EF 3.1 | 41272-40-6 | Methanaminium, <em>N</em>-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-<em>N</em>-methyl-… | flow |
| info | 1-(2-chlorophenyl)-n,n-dimethylmethanamine | EF 3.1 | 10175-31-2 | 2-Chloro-<em>N</em>,<em>N</em>-dimethylbenzenemethanamine | flow |
| info | Fatty Acids, C18-unsatd., Dimers Distillation Product | EF 3.1 | 61788-89-4 | Unsaturated fatty acids, C<sub>18</sub>, dimers | flow |
| info | Pentasodium Triphosphate | EF 3.1 | 7758-29-4 | Sodium tripolyphosphate | flow |
| info | 2-methylbenzene-1,4-diyl Bis{4-[4-(acryloyloxy)butoxy]benzoate} | EF 3.1 | 132900-75-5 | 1,1′-(2-Methyl-1,4-phenylene) bis[4-[4-[(1-oxo-2-propen-1-yl)oxy]butoxy]benzoate] | flow |