Common Chemistry name differences
Common Chemistry knows this CAS and calls it something else. Nothing was changed: a name is not evidence of identity the way a CAS is, and the flow's own name may be what its source list needs.
commonchem-cas-name-differences
| Severity | Flow | Source | CAS | Common Chemistry calls it | Links |
|---|---|---|---|---|---|
| info | Sodium Lauryl Ether Sulfate | EF 3.1 | 9004-82-4 | Polyoxyethylene lauryl ether sodium sulfate | flow |
| info | Disodium 4,4'-bis(2-hydroxynaphthalen-1-ylazo)biphenyl-2,6'-disulphonate | EF 3.1 | 10169-02-5 | C.I. Acid Red 97 | flow |
| info | 4-methoxy-(4'-trifluoromethylbenzoyl)butane | EF 3.1 | 61718-80-7 | 5-Methoxy-1-[4-(trifluoromethyl)phenyl]-1-pentanone | flow |
| info | Tridecylamine | EF 3.1 | 2869-34-3 | Tridecanamine | flow |
| info | 2,5-dihydrothiophene 1,1-dioxide | EF 3.1 | 77-79-2 | 3-Sulfolene | flow |
| info | 1,1-dimethylpropyl 2-(ethylperoxy)hexanoate | EF 3.1 | 686-31-7 | <em>tert</em>-Amyl peroxy-2-ethylhexanoate | flow |
| info | Ferrate(2-), [[n,n'-1,2-ethanediylbis[n-[(carboxy-ko)methyl]glycinato-kn,ko]](4-)]hydroxy-, Ammonium (1:2), (pb-7-11'-1… | EF 3.1 | 68413-60-5 | Ferrate(2-), [[<em>N</em>,<em>N</em>′-1,2-ethanediylbis[<em>N</em>-[(carboxy-κ<em>O</em>)methyl]glycinato-κ<em>N</em>,κ… | flow |
| info | Butanedioic Acid, Sulfo-, 1,4-diisotridecyl Ester, Sodium Salt | EF 3.1 | 55184-72-0 | Butanedioic acid, 2-sulfo-, 1,4-diisotridecyl ester, sodium salt (1:1) | flow |
| info | Sodium Tetrahydridoborate | EF 3.1 | 16940-66-2 | Sodium borohydride | flow |
| info | Acetic Acid; Zirconium | EF 3.1 | 7585-20-8 | Acetic acid, zirconium salt (1:?) | flow |
| info | Alcohols,c9-11-iso- | EF 3.1 | 68526-85-2 | Alcohols, C<sub>9-11</sub>-iso-, C<sub>10</sub>-rich | flow |
| info | Cellulose, Nitrate | EF 3.1 | 9004-70-0 | Nitrocellulose | flow |
| info | 2-ethylhexyl 10-ethyl-4-({2-[(2-ethylhexyl)oxy]-2-oxoethyl}sulfanyl)-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecan… | EF 3.1 | 57583-34-3 | Methyltin tris(2-ethylhexyl mercaptoacetate) | flow |
| info | 3-diethylaminophenol | EF 3.1 | 91-68-9 | 3-(Diethylamino)phenol | flow |
| info | Fenson | EF 3.1 | 80-38-6 | 4-Chlorophenyl benzenesulfonate | flow |
| info | Alcohols, C6-12 | EF 3.1 | 68603-15-6 | Alcohols, C<sub>6-12</sub> | flow |
| info | Ethane-1,2-diyl Dinitrate | EF 3.1 | 628-96-6 | Glycol dinitrate | flow |
| info | S-ethyl (4-chloro-2-methylphenoxy)ethanethioate | EF 3.1 | 25319-90-8 | MCPA-thioethyl | flow |
| info | 1-cyanoprop-2-en-1-yl Acetate | EF 3.1 | 15667-63-7 | Acrolein cyanohydrin acetate | flow |
| info | 2-(isopropylthio)-3-(2,2,2-trifluoroethoxy)pyridine | EF 3.1 | 256473-05-9 | 2-[(1-Methylethyl)thio]-3-(2,2,2-trifluoroethoxy)pyridine | flow |
| info | Trimethoxy(octyl)silane | EF 3.1 | 3069-40-7 | Octyltrimethoxysilane | flow |
| info | 3-(3-tert-butylphenyl)-2-methylpropanal | EF 3.1 | 62518-65-4 | 3-(1,1-Dimethylethyl)-α-methylbenzenepropanal | flow |
| info | Iron(2+) Dicyclopenta-2,4-dienide | EF 3.1 | 102-54-5 | Ferrocene | flow |
| info | O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | EF 3.1 | 18854-01-8 | Isoxathion | flow |
| info | 2-(4-{4-[difluoro(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl}phenyl)-5-ethyloxane | EF 3.1 | 787582-75-6 | 2-[4′-[Difluoro(3,4,5-trifluorophenoxy)methyl]-3′,5′-difluoro[1,1′-biphenyl]-4-yl]-5-ethyltetrahydro-2<em>H</em>-pyran | flow |
| info | Tripotassium Hydrogen 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate | EF 3.1 | 17572-97-3 | Tripotassium ethylenediaminetetraacetate | flow |
| info | 2-chloro-N-[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]benzamide | EF 3.1 | 64628-44-0 | Triflumuron | flow |
| info | Di-tert-butyl Dicarbonate | EF 3.1 | 24424-99-5 | Di-<em>tert</em>-butyl dicarbonate | flow |
| info | Tricyclo[2.2.2.2~1,4~]decane-2,5-diyldimethanol | EF 3.1 | 26896-48-0 | Tricyclodecanedimethanol | flow |
| info | 4,4'-[(3,3'-dichlorobiphenyl-4,4'-diyl)didiazene-2,1-diyl]bis[5-methyl-2-(4-methylphenyl)-2,4-dihydro-3h-pyrazol-3-one] | EF 3.1 | 15793-73-4 | Pigment Orange 34 | flow |
| info | 2,6-dichloro-p-cresol | EF 3.1 | 2432-12-4 | 2,6-Dichloro-4-methylphenol | flow |
| info | Reaction Mass Of 2,2-dimethyl-3-[(2e)-3-methyl-2,4-pentadien-1-yl]oxirane And 2,2-dimethyl-3-[(2z)-3-methyl-2,4-pentadi… | EF 3.1 | 69103-20-4 | 2,2-Dimethyl-3-(3-methyl-2,4-pentadien-1-yl)oxirane | flow |
| info | O,O,O',O'-tetrapropyl Pyrophosphorothioate | EF 3.1 | 3244-90-4 | Aspon | flow |
| info | Benzo(b)naphtho(1,2-d)thiophene | EF 3.1 | 205-43-6 | Benzo[<em>b</em>]naphtho[1,2-<em>d</em>]thiophene | flow |
| info | Tridecylamine | EF 3.1 | 2869-34-3 | Tridecanamine | flow |
| info | Ethyl 2-cyano-3-oxobutanoate | EF 3.1 | 634-55-9 | Butanoic acid, 2-cyano-3-oxo-, ethyl ester | flow |
| info | 2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol | EF 3.1 | 32492-61-8 | Ethoxylated bisphenol A | flow |
| info | Camphene | EF 3.1 | 79-92-5 | (±)-Camphene | flow |
| info | 4-methyl-m-phenylene Diisocyanate | EF 3.1 | 584-84-9 | Toluene 2,4-diisocyanate | flow |
| info | 2-tert-butylcyclohexyl Acetate | EF 3.1 | 20298-69-5 | <em>cis</em>-2-<em>tert</em>-Butylcyclohexyl acetate | flow |
| info | Bis(2-ethylhexyl) 4,4’-{6-[4-tert-butylcarbamoyl)anilino]-1,3,5-triazine-2,4-diyldiimino}dibenzoate | EF 3.1 | 154702-15-5 | Benzoic acid, 4,4′-[[6-[[4-[[(1,1-dimethylethyl)amino]carbonyl]phenyl]amino]-1,3,5-triazine-2,4-diyl]diimino]bis-, 1,1′… | flow |
| info | 4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) | EF 3.1 | 111850-25-0 | 4,4′,4′′-(1-Methyl-1-propanyl-3-ylidene)tris[2-cyclohexyl-5-methylphenol] | flow |
| info | 4-butoxy-4-oxobut-2-enoic Acid | EF 3.1 | 925-21-3 | Monobutyl maleate | flow |
| info | Fumaroyl Chloride | EF 3.1 | 627-63-4 | Fumaryl chloride | flow |
| info | Methylene Chloride | EF 3.1 | 75-09-2 | Dichloromethane | flow |
| info | N-(2-nitrophenyl)phosphoric Triamide | EF 3.1 | 874819-71-3 | <em>N</em>-(2-Nitrophenyl)phosphoric triamide | flow |
| info | [(5-(4-hydroxy-2,6,6-trimethyl-3-oxo-1-cyclohexen-1-yl)-3-methyl-2,4-pentadienyl](triphenyl)phosphonium Bromide | EF 3.1 | 84592-32-5 | Phosphonium, [5-(4-hydroxy-2,6,6-trimethyl-3-oxo-1-cyclohexen-1-yl)-3-methyl-2,4-pentadien-1-yl]triphenyl-, bromide (1:… | flow |
| info | Cineole | EF 3.1 | 470-82-6 | 1,8-Cineole | flow |
| info | Terpenes | EF 3.1 | 68956-56-9 | Hydrocarbons, terpene processing by-products | flow |
| info | 3-trimethoxysilylpropanenitrile | EF 3.1 | 2526-62-7 | Cyanoethyltrimethoxysilane | flow |